Difference between revisions of "RXN-13414"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13414 RXN-13414] == * direction: ** LEFT-TO-RIGHT * common name: ** Deoxyhypusine synthase * Sy...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13414 RXN-13414] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Deoxyhypusine synthase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[SPERMIDINE]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CPD-14378]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 spermidine[c] '''+''' 1 NAD+[c] '''=>''' 1 dehydrospermidine[c] '''+''' 1 H+[c] '''+''' 1 NADH[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-27_002000]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-5905]], hypusine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5905 PWY-5905] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19908 19908] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: common name=Deoxyhypusine synthase}} |
− | {{#set: | + | {{#set: gene associated=Ec-27_002000}} |
− | {{#set: | + | {{#set: in pathway=PWY-5905}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Contents
Reaction RXN-13414
- direction:
- LEFT-TO-RIGHT
- common name:
- Deoxyhypusine synthase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 SPERMIDINE[c] + 1 NAD[c] => 1 CPD-14378[c] + 1 PROTON[c] + 1 NADH[c]
- With common name(s):
- 1 spermidine[c] + 1 NAD+[c] => 1 dehydrospermidine[c] + 1 H+[c] + 1 NADH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_002000
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA: