Difference between revisions of "CPD-15373"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-0 CPD1G-0] == * smiles: ** C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=GZCGUP...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == |
* smiles: | * smiles: | ||
− | ** | + | ** [CH](=O)C(O)C(O)C(O)C(O)CO |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N |
* common name: | * common name: | ||
− | ** | + | ** aldehydo-D-mannose |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14501]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14500]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161658 161658] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37675 37675] |
− | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)CO}} | |
− | + | {{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N}} | |
− | + | {{#set: common name=aldehydo-D-mannose}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=180.157 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN-14501}} |
− | {{#set: common name= | + | {{#set: reversible reaction associated=RXN-14500}} |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite CPD-15373
- smiles:
- [CH](=O)C(O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N
- common name:
- aldehydo-D-mannose
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.