Difference between revisions of "RXN-16624"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == * smiles: ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) * in...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16624 RXN-16624] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucose/ribitol dehydrogena...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16624 RXN-16624] ==
−
* smiles:
+
* direction:
−
** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N
+
 
* common name:
 
* common name:
−
** (2R,3S,4S)-leucodelphinidin
+
** Glucose/ribitol dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 322.271   
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** (2R,3S,4S)-leucoefdin
 
−
** (2R,3S,4S)-leucodelfinidin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-7784]]
+
** 1 [[2E-7Z-hexadeca-2-7-dienoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[7Z-hexadec-7-enoyl-ACPs]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a (2E,7Z)-hexadeca-2,7-dienoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a (7Z)-hexadec-7-enoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_002470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664]
 +
** '''10''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05909 C05909]
+
{{#set: common name=Glucose/ribitol dehydrogenase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-1.3.1.9}}
−
** [http://www.chemspider.com/Chemical-Structure.2338991.html 2338991]
+
{{#set: gene associated=Ec-27_002470}}
−
* CHEBI:
+
{{#set: in pathway=PWY-7664}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6417 6417]
+
{{#set: reconstruction category=annotation}}
−
* METABOLIGHTS : MTBLC71216
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O)}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N}}
+
−
{{#set: common name=(2R,3S,4S)-leucodelphinidin}}
+
−
{{#set: molecular weight=322.271    }}
+
−
{{#set: common name=(2R,3S,4S)-leucoefdin|(2R,3S,4S)-leucodelfinidin}}
+
−
{{#set: produced by=RXN-7784}}
+

Latest revision as of 20:38, 21 March 2018

Reaction RXN-16624

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glucose/ribitol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7664, oleate biosynthesis IV (anaerobic): PWY-7664
    • 10 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-16624&oldid=28387"