Difference between revisions of "R07063"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R07063 R07063] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With identi...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R07063 R07063] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1.0 [[Donor-H2]][c] '''+''' 1.0 [[OXYGEN-MOLECULE]][c] '''+''' 1.0 [[LINOLEIC_ACID]][c] '''=>''' 1.0 [[CPD-8117]][c] '''+''' 2.0 [[WATER]][c] '''+''' 1.0 [[Acceptor]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1.0 an reduced unknown electron acceptor[c] '''+''' 1.0 oxygen[c] '''+''' 1.0 linoleate[c] '''=>''' 1.0 γ-linolenate[c] '''+''' 2.0 H2O[c] '''+''' 1.0 an oxidized unknown electron acceptor[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[manual]] | ||
| + | ** Source: [[manual-1_keggrxns_to_add]] | ||
| + | *** Comment: [[reaction from kegg for the production of cpd-8117 (gamma-linolenate)]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=manual}} | |
| − | + | {{#set: reconstruction source=manual-1_keggrxns_to_add}} | |
| − | {{#set: | + | {{#set: reconstruction comment=reaction from kegg for the production of cpd-8117 (gamma-linolenate)}} |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:38, 21 March 2018
Contents
Reaction R07063
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 Donor-H2[c] + 1.0 OXYGEN-MOLECULE[c] + 1.0 LINOLEIC_ACID[c] => 1.0 CPD-8117[c] + 2.0 WATER[c] + 1.0 Acceptor[c]
- With common name(s):
- 1.0 an reduced unknown electron acceptor[c] + 1.0 oxygen[c] + 1.0 linoleate[c] => 1.0 γ-linolenate[c] + 2.0 H2O[c] + 1.0 an oxidized unknown electron acceptor[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: manual
