Difference between revisions of "CPD1G-0"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CARBODEHYDRAT-RXN CARBODEHYDRAT-RXN] == * direction: ** REVERSIBLE * common name: ** Carbonic anhyd...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-0 CPD1G-0] == * smiles: ** C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O) * inchi...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-0 CPD1G-0] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O) |
+ | * inchi key: | ||
+ | ** InChIKey=HEPUIGACZYVUCD-LFIKJOHQSA-O | ||
* common name: | * common name: | ||
− | ** | + | ** 1-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol |
− | + | * molecular weight: | |
− | + | ** 342.322 | |
− | * | + | |
− | + | ||
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 6-(α-D-glucosaminyl)-1D-myo-inositol | ||
+ | ** GlcN-Ins | ||
+ | ** 1-(2-amino-2-deoxy-α-D-glucopyranoside)-1D-myo-inositol | ||
+ | ** 1-O-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol | ||
+ | ** glucosaminyl-inositol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN1G-121]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878468 46878468] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58886 58886] |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15658 C15658] | |
− | + | * HMDB : HMDB11668 | |
− | * | + | {{#set: smiles=C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=HEPUIGACZYVUCD-LFIKJOHQSA-O}} |
− | * | + | {{#set: common name=1-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol}} |
− | + | {{#set: molecular weight=342.322 }} | |
− | + | {{#set: common name=6-(α-D-glucosaminyl)-1D-myo-inositol|GlcN-Ins|1-(2-amino-2-deoxy-α-D-glucopyranoside)-1D-myo-inositol|1-O-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol|glucosaminyl-inositol}} | |
− | + | {{#set: consumed by=RXN1G-121}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite CPD1G-0
- smiles:
- C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)
- inchi key:
- InChIKey=HEPUIGACZYVUCD-LFIKJOHQSA-O
- common name:
- 1-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol
- molecular weight:
- 342.322
- Synonym(s):
- 6-(α-D-glucosaminyl)-1D-myo-inositol
- GlcN-Ins
- 1-(2-amino-2-deoxy-α-D-glucopyranoside)-1D-myo-inositol
- 1-O-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol
- glucosaminyl-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)" cannot be used as a page name in this wiki.