Difference between revisions of "RXN-7676"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] == * smiles: ** C(=O)([O-])OP([O-])(=O)O * inchi key: ** InChIKey=LQQCGEGR...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7676 RXN-7676] == * direction: ** LEFT-TO-RIGHT * common name: ** chlorophyllide-a monooxygenas...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7676 RXN-7676] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])OP([O-])(=O)O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** carboxyphosphate
+
** chlorophyllide-a monooxygenase
−
* molecular weight:
+
** chlorophyllide a oxygenase [overall]
−
** 139.989   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** chlorophyllide a oxygenase
 +
** chlorophyll-b synthase
 +
** CAO
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16910]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[CHLOROPHYLLIDE-A]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-7015]][c] '''+''' 1 [[WATER]][c]
−
* [[RXN-16909]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 chlorophyllide a[c] '''+''' 1 NADPH[c] '''+''' 1 oxygen[c] '''=>''' 1 NADP+[c] '''+''' 1 71-hydroxychlorophyllide a[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-06_002880]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-03_003240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_002860]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_002840]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-28_000110]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-11_003750]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-14_003590]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-5068]], chlorophyll cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5068 PWY-5068]
 +
** '''2''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CHEMSPIDER:
+
* RHEA:
−
** [http://www.chemspider.com/Chemical-Structure.169776.html 169776]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22676 22676]
−
{{#set: smiles=C(=O)([O-])OP([O-])(=O)O}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R08203 R08203]
−
{{#set: common name=carboxyphosphate}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=139.989    }}
+
{{#set: common name=chlorophyllide-a monooxygenase}}
−
{{#set: consumed by=RXN-16910}}
+
{{#set: common name=chlorophyllide a oxygenase [overall]}}
−
{{#set: produced by=RXN-16909}}
+
{{#set: common name=chlorophyllide a oxygenase|chlorophyll-b synthase|CAO}}
 +
{{#set: gene associated=Ec-06_002880|Ec-03_003240|Ec-06_002860|Ec-06_002840|Ec-28_000110|Ec-11_003750|Ec-14_003590}}
 +
{{#set: in pathway=PWY-5068}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:38, 21 March 2018

Reaction RXN-7676

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • chlorophyllide-a monooxygenase
    • chlorophyllide a oxygenase [overall]
  • Synonym(s):
    • chlorophyllide a oxygenase
    • chlorophyll-b synthase
    • CAO

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5068, chlorophyll cycle: PWY-5068
    • 2 reactions found over 6 reactions in the full pathway

Reconstruction information

External links


"chlorophyllide a oxygenase [overall" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-7676&oldid=28408"