Difference between revisions of "CPD-9925"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-10_005480 == * left end position: ** 5548654 * transcription direction: ** POSITIVE * right end position: ** 5561732 * centisome position: ** 85.3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9925 CPD-9925] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-10_005480 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9925 CPD-9925] ==
* left end position:
+
* smiles:
** 5548654
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=PYTINLGPKDJURZ-HSJNEKGZSA-J
* right end position:
+
* common name:
** 5561732
+
** 1,4-dihydroxy-2-naphthoyl-CoA
* centisome position:
+
* molecular weight:
** 85.350975    
+
** 949.669    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0006_0079
+
** 1,4-dihydroxy-2-naphthoate-CoA
** Esi0006_0079
+
** DHNA-CoA
** PK
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Source: [[annotation-esiliculosus_genome]]
+
* [[NAPHTHOATE-SYN-RXN]]
*** Assignment: go-term
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=5548654}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878473 46878473]
{{#set: right end position=5561732}}
+
* CHEBI:
{{#set: centisome position=85.350975   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58897 58897]
{{#set: common name=Esi_0006_0079|Esi0006_0079|PK}}
+
* LIGAND-CPD:
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15547 C15547]
 +
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=PYTINLGPKDJURZ-HSJNEKGZSA-J}}
 +
{{#set: common name=1,4-dihydroxy-2-naphthoyl-CoA}}
 +
{{#set: molecular weight=949.669   }}
 +
{{#set: common name=1,4-dihydroxy-2-naphthoate-CoA|DHNA-CoA}}
 +
{{#set: produced by=NAPHTHOATE-SYN-RXN}}

Latest revision as of 19:39, 21 March 2018

Metabolite CPD-9925

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
  • inchi key:
    • InChIKey=PYTINLGPKDJURZ-HSJNEKGZSA-J
  • common name:
    • 1,4-dihydroxy-2-naphthoyl-CoA
  • molecular weight:
    • 949.669
  • Synonym(s):
    • 1,4-dihydroxy-2-naphthoate-CoA
    • DHNA-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-" cannot be used as a page name in this wiki.