Difference between revisions of "CPD0-2106"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_003990 == * left end position: ** 3337332 * transcription direction: ** NEGATIVE * right end position: ** 3350251 * centisome position: ** 32.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] == * smiles: ** CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WPIVBCGRGVNDDT-CECATXLMSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 3-oxooctanoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 903.684 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | * [[RXN-14277]] | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05267 C05267] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62619 62619] |
| − | {{#set: | + | * BIGG : 45463 |
| − | {{#set: reaction associated=RXN- | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173417 46173417] | ||
| + | * HMDB : HMDB03941 | ||
| + | {{#set: smiles=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=WPIVBCGRGVNDDT-CECATXLMSA-J}} | ||
| + | {{#set: common name=3-oxooctanoyl-CoA}} | ||
| + | {{#set: molecular weight=903.684 }} | ||
| + | {{#set: reversible reaction associated=RXN-14277}} | ||
Latest revision as of 19:39, 21 March 2018
Contents
Metabolite CPD0-2106
- smiles:
- CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=WPIVBCGRGVNDDT-CECATXLMSA-J
- common name:
- 3-oxooctanoyl-CoA
- molecular weight:
- 903.684
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
