Difference between revisions of "Charged-GLN-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7222 CPD-7222] == * smiles: ** CCCCCCCCCC=CC(SCCNC(CCNC(C(C(COP(OP(OCC3(OC(N2(C1(=C(C(=NC=N...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-GLN-tRNAs Charged-GLN-tRNAs] == * common name: ** an L-glutaminyl-[tRNAgln] * Synonym(s...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7222 CPD-7222] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-GLN-tRNAs Charged-GLN-tRNAs] ==
* smiles:
+
** CCCCCCCCCC=CC(SCCNC(CCNC(C(C(COP(OP(OCC3(OC(N2(C1(=C(C(=NC=N1)N)N=C2)))C(C3OP([O-])([O-])=O)O))([O-])=O)([O-])=O)(C)C)O)=O)=O)=O
+
* inchi key:
+
** InChIKey=IRFYVBULXZMEDE-XCFIPPSPSA-J
+
 
* common name:
 
* common name:
** trans-dodec-2-enoyl-CoA
+
** an L-glutaminyl-[tRNAgln]
* molecular weight:
+
** 943.792   
+
 
* Synonym(s):
 
* Synonym(s):
** (2E)-dodecenoyl-CoA
+
** glutaminyl-tRNA
** 2-trans-dodecenoyl-CoA
+
** L-glutaminyl-tRNA(gln)
** (2E)-dodec-2-enoyl-CoA
+
** gln-tRNA(gln)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[6.3.5.7-RXN]]
 +
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-7931]]
 
 
== External links  ==
 
== External links  ==
* BIGG : 41433
+
{{#set: common name=an L-glutaminyl-[tRNAgln]}}
* PUBCHEM:
+
{{#set: common name=glutaminyl-tRNA|L-glutaminyl-tRNA(gln)|gln-tRNA(gln)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245396 25245396]
+
{{#set: produced by=6.3.5.7-RXN|GLUTAMINE--TRNA-LIGASE-RXN}}
* HMDB : HMDB03712
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03221 C03221]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57330 57330]
+
* METABOLIGHTS : MTBLC57330
+
{{#set: smiles=CCCCCCCCCC=CC(SCCNC(CCNC(C(C(COP(OP(OCC3(OC(N2(C1(=C(C(=NC=N1)N)N=C2)))C(C3OP([O-])([O-])=O)O))([O-])=O)([O-])=O)(C)C)O)=O)=O)=O}}
+
{{#set: inchi key=InChIKey=IRFYVBULXZMEDE-XCFIPPSPSA-J}}
+
{{#set: common name=trans-dodec-2-enoyl-CoA}}
+
{{#set: molecular weight=943.792    }}
+
{{#set: common name=(2E)-dodecenoyl-CoA|2-trans-dodecenoyl-CoA|(2E)-dodec-2-enoyl-CoA}}
+
{{#set: reversible reaction associated=RXN-7931}}
+

Latest revision as of 19:39, 21 March 2018

Metabolite Charged-GLN-tRNAs

  • common name:
    • an L-glutaminyl-[tRNAgln]
  • Synonym(s):
    • glutaminyl-tRNA
    • L-glutaminyl-tRNA(gln)
    • gln-tRNA(gln)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-glutaminyl-[tRNAgln" cannot be used as a page name in this wiki.