Difference between revisions of "CPD-5821"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16043 RXN-16043] == * direction: ** LEFT-TO-RIGHT * common name: ** Lyso-phosphatidylcholine ac...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] == * smiles: ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] * inchi key: ** InChIKey...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16043 RXN-16043] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]
 +
* inchi key:
 +
** InChIKey=WHKYNCPIXMNTRQ-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** Lyso-phosphatidylcholine acyltransferase
+
** 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23]
+
** 201.118   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate
 +
** OHCU
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-6201]]
−
** 1 [[Gamma-linolenoyl-groups]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[GAMMA-LINOLENOYL-COA]][c] '''+''' 1 [[Glycerolipids]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[3.5.2.17-RXN]]
−
** 1 a [glycerolipid]-γ-linolenate[c] '''+''' 1 coenzyme A[c] '''=>''' 1 γ-linolenoyl-CoA[c] '''+''' 1 a glycerolipid[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-16_002160]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5353]], arachidonate biosynthesis I (6-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5353 PWY-5353]
+
−
** '''2''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Lyso-phosphatidylcholine acyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145222 21145222]
−
{{#set: ec number=EC-2.3.1.23}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Ec-16_002160}}
+
** [http://www.chemspider.com/Chemical-Structure.20016217.html 20016217]
−
{{#set: in pathway=PWY-5353}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58639 58639]
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C12248 C12248]
 +
* HMDB : HMDB59663
 +
{{#set: smiles=C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=WHKYNCPIXMNTRQ-UHFFFAOYSA-M}}
 +
{{#set: common name=2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline}}
 +
{{#set: molecular weight=201.118    }}
 +
{{#set: common name=5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate|OHCU}}
 +
{{#set: consumed by=RXN-6201}}
 +
{{#set: produced by=3.5.2.17-RXN}}

Latest revision as of 19:39, 21 March 2018

Metabolite CPD-5821

  • smiles:
    • C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]
  • inchi key:
    • InChIKey=WHKYNCPIXMNTRQ-UHFFFAOYSA-M
  • common name:
    • 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
  • molecular weight:
    • 201.118
  • Synonym(s):
    • 5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate
    • OHCU

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-5821&oldid=28484"