Difference between revisions of "FRU1P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-12_008720 == * left end position: ** 7815541 * transcription direction: ** POSITIVE * right end position: ** 7822514 * centisome position: ** 93.7...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * smiles: ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) * inchi key: ** InChIKey...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-12_008720 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] ==
* left end position:
+
* smiles:
** 7815541
+
** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L
* right end position:
+
* common name:
** 7822514
+
** β-D-fructofuranose 1-phosphate
* centisome position:
+
* molecular weight:
** 93.755905    
+
** 258.121    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0067_0029
+
** β-D-fructofuranose-1-P
** Esi0067_0029
+
** LACS
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ACYLCOASYN-RXN]]
+
* [[RXN-8631]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
* [[LINOLENOYL-RXN]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[R223-RXN]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-12184]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-12978]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-13290]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-13614]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-16380]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-16389]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-16393]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-16401]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-16402]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-16415]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-16418]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-7904]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-9623]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-9644]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN-9673]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN0-7238]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN0-7239]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN0-7248]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN66-469]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN66-477]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN66-480]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN66-483]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN66-484]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[TRANS-RXN0-623]]
+
** esiliculosus_genome
+
***automated-name-match
+
== Pathways associated ==
+
* [[PWY-6920]]
+
* [[P221-PWY]]
+
* [[PWY-321]]
+
* [[PWY-5972]]
+
* [[PWY-5971]]
+
* [[PWY-7033]]
+
* [[PWY-5136]]
+
* [[PWY66-389]]
+
* [[PWY-7288]]
+
* [[PWY-6733]]
+
* [[PWY-7094]]
+
* [[PWY66-391]]
+
* [[FAO-PWY]]
+
* [[PWY-1121]]
+
* [[PWY-6873]]
+
* [[PWY-5147]]
+
* [[PWY-5143]]
+
* [[PWY-5885]]
+
* [[PWY-7724]]
+
* [[PWY-6001]]
+
* [[PWY-6000]]
+
* [[PWY-7049]]
+
* [[PWY66-387]]
+
* [[PWY-5989]]
+
* [[PWY-6803]]
+
* [[PWY66-388]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=7815541}}
+
* CAS : 15978-08-2
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
{{#set: right end position=7822514}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244216 25244216]
{{#set: centisome position=93.755905   }}
+
* BIGG : 40936
{{#set: common name=Esi_0067_0029|Esi0067_0029|LACS}}
+
{{#set: smiles=C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)}}
{{#set: reaction associated=ACYLCOASYN-RXN|LINOLENOYL-RXN|R223-RXN|RXN-12184|RXN-12978|RXN-13290|RXN-13614|RXN-16380|RXN-16389|RXN-16393|RXN-16401|RXN-16402|RXN-16415|RXN-16418|RXN-7904|RXN-9623|RXN-9644|RXN-9673|RXN0-7238|RXN0-7239|RXN0-7248|RXN66-469|RXN66-477|RXN66-480|RXN66-483|RXN66-484|TRANS-RXN0-623}}
+
{{#set: inchi key=InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L}}
{{#set: pathway associated=PWY-6920|P221-PWY|PWY-321|PWY-5972|PWY-5971|PWY-7033|PWY-5136|PWY66-389|PWY-7288|PWY-6733|PWY-7094|PWY66-391|FAO-PWY|PWY-1121|PWY-6873|PWY-5147|PWY-5143|PWY-5885|PWY-7724|PWY-6001|PWY-6000|PWY-7049|PWY66-387|PWY-5989|PWY-6803|PWY66-388}}
+
{{#set: common name=β-D-fructofuranose 1-phosphate}}
 +
{{#set: molecular weight=258.121   }}
 +
{{#set: common name=β-D-fructofuranose-1-P}}
 +
{{#set: consumed by=RXN-8631}}

Latest revision as of 19:39, 21 March 2018

Metabolite FRU1P

  • smiles:
    • C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)
  • inchi key:
    • InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L
  • common name:
    • β-D-fructofuranose 1-phosphate
  • molecular weight:
    • 258.121
  • Synonym(s):
    • β-D-fructofuranose-1-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 15978-08-2
  • PUBCHEM:
  • BIGG : 40936
"C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)" cannot be used as a page name in this wiki.