Difference between revisions of "Ec-02 005910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C4 C4] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=...")
 
(Created page with "Category:Gene == Gene Ec-02_005910 == * left end position: ** 6079457 * transcription direction: ** POSITIVE * right end position: ** 6088957 * centisome position: ** 93.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C4 C4] ==
+
== Gene Ec-02_005910 ==
* smiles:
+
* left end position:
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(OC(CO)C(O)C(OC(C)C(=O)NC(C)C(=O)NC(CCC(NC(CCCC[N+])C(=O)NC(C)C(NC(C(=O)[O-])C)=O)=O)C([O-])=O)C(NC(C)=O)1))([O-])=O)C)C)C)C)C)C)C
+
** 6079457
* inchi key:
+
* transcription direction:
** InChIKey=SULOOAFLXMQJSF-OGDYFQGPSA-K
+
** POSITIVE
* common name:
+
* right end position:
** undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanyl-D-alanine
+
** 6088957
* molecular weight:
+
* centisome position:
** 1670.034    
+
** 93.13192    
 
* Synonym(s):
 
* Synonym(s):
** mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala-D-Ala)-diphosphoundecaprenol
+
** Esi_0082_0071
** lipid I
+
** Esi0082_0071
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[AMIDASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[RXN-8975]]
+
*** Assignment: automated-name-match
 +
* Reaction: [[GUANIDINOBUTANAMIDE-NH3-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[PYRAZIN-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[R311-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14727]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14728]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-17608]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXNN-404]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-581]]
 +
* [[PWY-5025]]
 +
* [[PWY-3161]]
 +
* [[ARGDEG-V-PWY]]
 +
* [[PWY-7308]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=6079457}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878496 46878496]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=6088957}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60032 60032]
+
{{#set: centisome position=93.13192   }}
* LIGAND-CPD:
+
{{#set: common name=Esi_0082_0071|Esi0082_0071}}
** [http://www.genome.jp/dbget-bin/www_bget?C05888 C05888]
+
{{#set: reaction associated=AMIDASE-RXN|GUANIDINOBUTANAMIDE-NH3-RXN|PYRAZIN-RXN|R311-RXN|RXN-14727|RXN-14728|RXN-17608|RXNN-404}}
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(OC(CO)C(O)C(OC(C)C(=O)NC(C)C(=O)NC(CCC(NC(CCCC[N+])C(=O)NC(C)C(NC(C(=O)[O-])C)=O)=O)C([O-])=O)C(NC(C)=O)1))([O-])=O)C)C)C)C)C)C)C}}
+
{{#set: pathway associated=PWY-581|PWY-5025|PWY-3161|ARGDEG-V-PWY|PWY-7308}}
{{#set: inchi key=InChIKey=SULOOAFLXMQJSF-OGDYFQGPSA-K}}
+
{{#set: common name=undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanyl-D-alanine}}
+
{{#set: molecular weight=1670.034   }}
+
{{#set: common name=mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala-D-Ala)-diphosphoundecaprenol|lipid I}}
+
{{#set: consumed or produced by=RXN-8975}}
+

Latest revision as of 20:39, 21 March 2018

Gene Ec-02_005910

  • left end position:
    • 6079457
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6088957
  • centisome position:
    • 93.13192
  • Synonym(s):
    • Esi_0082_0071
    • Esi0082_0071

Reactions associated

Pathways associated

External links