Difference between revisions of "RXN-15560"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] == * smiles: ** C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15560 RXN-15560] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15560 RXN-15560] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.2.26 EC-2.3.2.26] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[S-ubiquitinyl-HECT-E3-UCP-L-cysteine]][c] '''+''' 1 [[Protein-L-lysine]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[PROTEIN-N-UBIQUITYL-LYSINE]][c] '''+''' 1 [[HECT-Ubiquitin-carrier-protein-E3-L-cys]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine[c] '''+''' 1 a [protein]-L-lysine[c] '''=>''' 1 H+[c] '''+''' 1 an N6-monoubiquitinyl-[protein]-L-lysine[c] '''+''' 1 a [HECT-type E3 ubiquitin transferase]-L-cysteine[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-7511]], protein ubiquitylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511] | ||
| + | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-2.3.2.26}} | |
| − | + | {{#set: in pathway=PWY-7511}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 20:40, 21 March 2018
Contents
Reaction RXN-15560
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-ubiquitinyl-HECT-E3-UCP-L-cysteine[c] + 1 Protein-L-lysine[c] => 1 PROTON[c] + 1 PROTEIN-N-UBIQUITYL-LYSINE[c] + 1 HECT-Ubiquitin-carrier-protein-E3-L-cys[c]
- With common name(s):
- 1 an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine[c] + 1 a [protein]-L-lysine[c] => 1 H+[c] + 1 an N6-monoubiquitinyl-[protein]-L-lysine[c] + 1 a [HECT-type E3 ubiquitin transferase]-L-cysteine[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
