Difference between revisions of "3-oxo-cis-D7-tetradecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * inchi key: ** InChIKey=NPYQJIHH...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-cis-D7-tetradecenoyl-ACPs 3-oxo-cis-D7-tetradecenoyl-ACPs] == * common name: ** a 3-oxo-c...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-cis-D7-tetradecenoyl-ACPs 3-oxo-cis-D7-tetradecenoyl-ACPs] ==
−
* smiles:
+
−
** CC(C(=O)[O-])C(O)C([O-])=O
+
−
* inchi key:
+
−
** InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L
+
 
* common name:
 
* common name:
−
** (2R,3S)-3-methylmalate
+
** a 3-oxo-cis-Δ7-tetradecenoyl-[acp]
−
* molecular weight:
+
−
** 146.099   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-erythro-3-methylmalate
 
−
** erythro-β-methyl-D-malate
 
−
** β-erythro-methylmalate
 
−
** β-methyl-D-malate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-7745]]
+
* [[RXN-10655]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10654]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a 3-oxo-cis-Δ7-tetradecenoyl-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266666 45266666]
+
{{#set: consumed by=RXN-10655}}
−
* CHEBI:
+
{{#set: produced by=RXN-10654}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58511 58511]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C06029 C06029]
+
−
{{#set: smiles=CC(C(=O)[O-])C(O)C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L}}
+
−
{{#set: common name=(2R,3S)-3-methylmalate}}
+
−
{{#set: molecular weight=146.099    }}
+
−
{{#set: common name=D-erythro-3-methylmalate|erythro-β-methyl-D-malate|β-erythro-methylmalate|β-methyl-D-malate}}
+
−
{{#set: consumed by=RXN-7745}}
+

Latest revision as of 20:40, 21 March 2018

Metabolite 3-oxo-cis-D7-tetradecenoyl-ACPs

  • common name:
    • a 3-oxo-cis-Δ7-tetradecenoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-cis-Δ7-tetradecenoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-oxo-cis-D7-tetradecenoyl-ACPs&oldid=28618"