Difference between revisions of "RXN-11486"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * smiles: ** CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2)) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11486 RXN-11486] == * direction: ** LEFT-TO-RIGHT * common name: ** solanesyl diphosphate synth...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11486 RXN-11486] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** solanesyl diphosphate synthase-like protein |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1.85 EC-2.5.1.85] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[GERANYLGERANYL-PP]][c] '''+''' 5 [[DELTA3-ISOPENTENYL-PP]][c] '''=>''' 1 [[SOLANESYL-PYROPHOSPHATE]][c] '''+''' 5 [[PPI]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 geranylgeranyl diphosphate[c] '''+''' 5 isopentenyl diphosphate[c] '''=>''' 1 all-trans-nonaprenyl diphosphate[c] '''+''' 5 diphosphate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-17_003520]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY-6520]], nonaprenyl diphosphate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6520 PWY-6520] | ||
| + | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27594 27594] |
| − | + | * LIGAND-RXN: | |
| − | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R09251 R09251] |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | + | {{#set: common name=solanesyl diphosphate synthase-like protein}} | |
| − | + | {{#set: ec number=EC-2.5.1.85}} | |
| − | + | {{#set: gene associated=Ec-17_003520}} | |
| − | + | {{#set: in pathway=PWY-6520}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:40, 21 March 2018
Contents
Reaction RXN-11486
- direction:
- LEFT-TO-RIGHT
- common name:
- solanesyl diphosphate synthase-like protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 GERANYLGERANYL-PP[c] + 5 DELTA3-ISOPENTENYL-PP[c] => 1 SOLANESYL-PYROPHOSPHATE[c] + 5 PPI[c]
- With common name(s):
- 1 geranylgeranyl diphosphate[c] + 5 isopentenyl diphosphate[c] => 1 all-trans-nonaprenyl diphosphate[c] + 5 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-17_003520
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6520, nonaprenyl diphosphate biosynthesis II: PWY-6520
- 1 reactions found over 1 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
