Difference between revisions of "Ec-12 008080"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CO)(O)C(O)C(O)1) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-12_008080 == * left end position: ** 7185120 * transcription direction: ** NEGATIVE * right end position: ** 7194666 * centisome position: ** 86.1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_008080 == |
− | * | + | * left end position: |
− | ** | + | ** 7185120 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 7194666 |
− | * | + | * centisome position: |
− | ** | + | ** 86.19332 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0130_0079 |
− | ** | + | ** Esi0130_0079 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[4-NITROPHENYLPHOSPHATASE-RXN]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | * [[ | + | * Reaction: [[GPH-RXN]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: automated-name-match |
− | + | == Pathways associated == | |
− | * | + | * [[PWY-181]] |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=7185120}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=7194666}} | |
− | + | {{#set: centisome position=86.19332 }} | |
− | + | {{#set: common name=Esi_0130_0079|Esi0130_0079}} | |
− | + | {{#set: reaction associated=4-NITROPHENYLPHOSPHATASE-RXN|GPH-RXN}} | |
− | + | {{#set: pathway associated=PWY-181}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:41, 21 March 2018
Gene Ec-12_008080
- left end position:
- 7185120
- transcription direction:
- NEGATIVE
- right end position:
- 7194666
- centisome position:
- 86.19332
- Synonym(s):
- Esi_0130_0079
- Esi0130_0079
Reactions associated
- Reaction: 4-NITROPHENYLPHOSPHATASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: GPH-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome