Difference between revisions of "Ec-24 000980"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * smiles: ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) * inchi key: *...")
 
(Created page with "Category:Gene == Gene Ec-24_000980 == * left end position: ** 992682 * transcription direction: ** POSITIVE * right end position: ** 999413 * centisome position: ** 19.902...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] ==
+
== Gene Ec-24_000980 ==
−
* smiles:
+
* left end position:
−
** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)
+
** 992682
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** pinocembrin chalcone
+
** 999413
−
* molecular weight:
+
* centisome position:
−
** 256.257    
+
** 19.902712    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0019_0088
 +
** Esi0019_0088
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7647]]
+
* Reaction: [[2.8.1.6-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-7645]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-17472]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-17473]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY0-1507]]
 +
* [[PWY-7380]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=992682}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6474295 6474295]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=999413}}
−
** [http://www.chemspider.com/Chemical-Structure.4976321.html 4976321]
+
{{#set: centisome position=19.902712    }}
−
* CHEBI:
+
{{#set: common name=Esi_0019_0088|Esi0019_0088}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80484 80484]
+
{{#set: reaction associated=2.8.1.6-RXN|RXN-17472|RXN-17473}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY0-1507|PWY-7380}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16404 C16404]
+
−
{{#set: smiles=C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)}}
+
−
{{#set: inchi key=InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N}}
+
−
{{#set: common name=pinocembrin chalcone}}
+
−
{{#set: molecular weight=256.257    }}
+
−
{{#set: consumed by=RXN-7647}}
+
−
{{#set: produced by=RXN-7645}}
+

Latest revision as of 20:41, 21 March 2018

Gene Ec-24_000980

  • left end position:
    • 992682
  • transcription direction:
    • POSITIVE
  • right end position:
    • 999413
  • centisome position:
    • 19.902712
  • Synonym(s):
    • Esi_0019_0088
    • Esi0019_0088

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-24_000980&oldid=28651"