Difference between revisions of "2E-5Z-tetradeca-2-5-dienoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * smiles: ** CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2)) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2E-5Z-tetradeca-2-5-dienoyl-ACPs 2E-5Z-tetradeca-2-5-dienoyl-ACPs] == * common name: ** a (2E,5...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2E-5Z-tetradeca-2-5-dienoyl-ACPs 2E-5Z-tetradeca-2-5-dienoyl-ACPs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a (2E,5Z)-tetradeca-2,5-dienoyl-[acp] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-16620]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a (2E,5Z)-tetradeca-2,5-dienoyl-[acp]}} | |
− | + | {{#set: consumed by=RXN-16620}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: consumed by=RXN- | + | |
− | + |
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite 2E-5Z-tetradeca-2-5-dienoyl-ACPs
- common name:
- a (2E,5Z)-tetradeca-2,5-dienoyl-[acp]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a (2E,5Z)-tetradeca-2,5-dienoyl-[acp" cannot be used as a page name in this wiki.