Difference between revisions of "RXN-115"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12653 CPD-12653] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)[O-] * common name: ** stearidon...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-115 RXN-115] == * direction: ** LEFT-TO-RIGHT * common name: ** Non-haem dioxygenase N-terminal...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12653 CPD-12653] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-115 RXN-115] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCCCCC(=O)[O-]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** stearidonate
+
** Non-haem dioxygenase N-terminal domain
−
* inchi key:
+
* ec number:
−
** InChIKey=JIWBIWFOSCKQMA-LTKCOYKYSA-M
+
** [http://enzyme.expasy.org/EC/1.14.11.13 EC-1.14.11.13]
−
* molecular weight:
+
−
** 275.41   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate
 
−
** ((6Z,9Z,12Z,15Z)-octadecatetraenoate
 
−
** all-cis-octadeca-6,9,12,15-tetraenoic acid
 
−
** (6Z,9Z,12Z,15Z)-octadecatetraenoic acid
 
−
** octadecatetraenoate
 
−
** stearidonic acid
 
−
** octadecatetraenoic acid
 
−
** cis-6,9,12,15-octadecatetraenoate
 
−
** 6,9,12,15-(Z,Z,Z,Z)-octadecatetraenoic acid
 
−
** cis-6,9,12,15-octadecatetraenoic acid
 
−
** (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoic acid
 
−
** moroctic acid
 
−
** moroctate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-139]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 1 [[SUC]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-204]][c]
−
* [[RXN-8349_PLANTCYC]]
+
* With common name(s):
−
* [[R07861]]
+
** 1 oxygen[c] '''+''' 1 gibberellin A1[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 1 succinate[c] '''+''' 1 CO2[c] '''+''' 1 gibberellin A8[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-08_003510]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-19_002760]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-19_002750]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-102]], gibberellin inactivation I (2β-hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-102 PWY-102]
 +
** '''4''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* Wikipedia : Stearidonic_acid
+
* RHEA:
−
* HMDB : HMDB06547
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15005 15005]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77222 77222]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03008 R03008]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245840 25245840]
+
{{#set: common name=Non-haem dioxygenase N-terminal domain}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.14.11.13}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16300 C16300]
+
{{#set: gene associated=Ec-08_003510|Ec-19_002760|Ec-19_002750}}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(=O)[O-]}}
+
{{#set: in pathway=PWY-102}}
−
{{#set: common name=stearidonate}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: inchi key=InChIKey=JIWBIWFOSCKQMA-LTKCOYKYSA-M}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: molecular weight=275.41    }}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate|((6Z,9Z,12Z,15Z)-octadecatetraenoate|all-cis-octadeca-6,9,12,15-tetraenoic acid|(6Z,9Z,12Z,15Z)-octadecatetraenoic acid|octadecatetraenoate|stearidonic acid|octadecatetraenoic acid|cis-6,9,12,15-octadecatetraenoate|6,9,12,15-(Z,Z,Z,Z)-octadecatetraenoic acid|cis-6,9,12,15-octadecatetraenoic acid|(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoic acid|moroctic acid|moroctate}}
+
−
{{#set: consumed or produced by=RXN-8349_PLANTCYC|R07861}}
+

Latest revision as of 19:41, 21 March 2018

Reaction RXN-115

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Non-haem dioxygenase N-terminal domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-102, gibberellin inactivation I (2β-hydroxylation): PWY-102
    • 4 reactions found over 11 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-115&oldid=28678"