Difference between revisions of "RXN-115"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12653 CPD-12653] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)[O-] * common name: ** stearidon...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-115 RXN-115] == * direction: ** LEFT-TO-RIGHT * common name: ** Non-haem dioxygenase N-terminal...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-115 RXN-115] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** Non-haem dioxygenase N-terminal domain |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.14.11.13 EC-1.14.11.13] | |
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-139]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 1 [[SUC]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-204]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 oxygen[c] '''+''' 1 gibberellin A1[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 1 succinate[c] '''+''' 1 CO2[c] '''+''' 1 gibberellin A8[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-08_003510]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-19_002760]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-19_002750]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-102]], gibberellin inactivation I (2β-hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-102 PWY-102] | ||
+ | ** '''4''' reactions found over '''11''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15005 15005] | |
− | + | * LIGAND-RXN: | |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03008 R03008] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Non-haem dioxygenase N-terminal domain}} | |
− | * LIGAND- | + | {{#set: ec number=EC-1.14.11.13}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Ec-08_003510|Ec-19_002760|Ec-19_002750}} |
− | {{#set: | + | {{#set: in pathway=PWY-102}} |
− | {{#set: common name= | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:41, 21 March 2018
Contents
Reaction RXN-115
- direction:
- LEFT-TO-RIGHT
- common name:
- Non-haem dioxygenase N-terminal domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OXYGEN-MOLECULE[c] + 1 CPD1F-139[c] + 1 2-KETOGLUTARATE[c] => 1 SUC[c] + 1 CARBON-DIOXIDE[c] + 1 CPD-204[c]
- With common name(s):
- 1 oxygen[c] + 1 gibberellin A1[c] + 1 2-oxoglutarate[c] => 1 succinate[c] + 1 CO2[c] + 1 gibberellin A8[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-08_003510
- Source: orthology-aragem
- Gene: Ec-19_002760
- Source: orthology-aragem
- Gene: Ec-19_002750
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- PWY-102, gibberellin inactivation I (2β-hydroxylation): PWY-102
- 4 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links