Difference between revisions of "MELIBIOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATEMUT-RXN CHORISMATEMUT-RXN] == * direction: ** REVERSIBLE * common name: ** Chorismate mut...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O * inchi key:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATEMUT-RXN CHORISMATEMUT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O
 +
* inchi key:
 +
** InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N
 
* common name:
 
* common name:
−
** Chorismate mutase, AroQ class, eukaryotic type
+
** melibiose
−
** Trifunctional Chorismate Mutase/Prephenate Dehydratase/Prephenate Dehydrogenase
+
* molecular weight:
−
* ec number:
+
** 342.299   
−
** [http://enzyme.expasy.org/EC/5.4.99.5 EC-5.4.99.5]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-O-(α-D-galactopyranosyl)-D-glucopyranose
 +
** D-Gal-α(1->6)-D-glucose
 +
** D-melibiose
 +
** 6-O-α-D-galactopyranosyl-D-glucose
 +
** 6-(α-D-galactosido)-D-glucose
 +
** α-D-Galp-(1->6)-D-Glc
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[ALPHAGALACTOSID-RXN]]
−
** 1 [[CHORISMATE]][c] '''<=>''' 1 [[PREPHENATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 chorismate[c] '''<=>''' 1 prephenate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_007700]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-27_003130]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PHESYN]], L-phenylalanine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PHESYN PHESYN]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6120]], L-tyrosine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6120 PWY-6120]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-3462]], L-phenylalanine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3462 PWY-3462]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-3461]], L-tyrosine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3461 PWY-3461]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-7626]], bacilysin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7626 PWY-7626]
+
−
** '''1''' reactions found over '''10''' reactions in the full pathway
+
−
* [[TYRSYN]], L-tyrosine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=TYRSYN TYRSYN]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6627]], salinosporamide A biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6627 PWY-6627]
+
−
** '''2''' reactions found over '''15''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 585-99-9
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13897 13897]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11458 11458]
−
** [http://www.genome.jp/dbget-bin/www_bget?R01715 R01715]
+
* HMDB : HMDB00048
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P19080 P19080]
+
** [http://www.genome.jp/dbget-bin/www_bget?C05402 C05402]
−
** [http://www.uniprot.org/uniprot/P27603 P27603]
+
* CHEMSPIDER:
−
** [http://www.uniprot.org/uniprot/P32178 P32178]
+
** [http://www.chemspider.com/Chemical-Structure.10974.html 10974]
−
** [http://www.uniprot.org/uniprot/P43900 P43900]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/Q9RQV7 Q9RQV7]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61827 61827]
−
** [http://www.uniprot.org/uniprot/P21204 P21204]
+
* BIGG : 45736
−
** [http://www.uniprot.org/uniprot/Q58029 Q58029]
+
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O}}
−
** [http://www.uniprot.org/uniprot/Q57696 Q57696]
+
{{#set: inchi key=InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N}}
−
** [http://www.uniprot.org/uniprot/P43902 P43902]
+
{{#set: common name=melibiose}}
−
** [http://www.uniprot.org/uniprot/Q9PII3 Q9PII3]
+
{{#set: molecular weight=342.299    }}
−
** [http://www.uniprot.org/uniprot/P0A9J8 P0A9J8]
+
{{#set: common name=6-O-(&alpha;-D-galactopyranosyl)-D-glucopyranose|D-Gal-&alpha;(1->6)-D-glucose|D-melibiose|6-O-&alpha;-D-galactopyranosyl-D-glucose|6-(&alpha;-D-galactosido)-D-glucose|&alpha;-D-Galp-(1->6)-D-Glc}}
−
** [http://www.uniprot.org/uniprot/P07023 P07023]
+
{{#set: consumed by=ALPHAGALACTOSID-RXN}}
−
** [http://www.uniprot.org/uniprot/Q02286 Q02286]
+
−
** [http://www.uniprot.org/uniprot/Q02287 Q02287]
+
−
** [http://www.uniprot.org/uniprot/P42738 P42738]
+
−
** [http://www.uniprot.org/uniprot/O22409 O22409]
+
−
** [http://www.uniprot.org/uniprot/O22410 O22410]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=Chorismate mutase, AroQ class, eukaryotic type}}
+
−
{{#set: common name=Trifunctional Chorismate Mutase/Prephenate Dehydratase/Prephenate Dehydrogenase}}
+
−
{{#set: ec number=EC-5.4.99.5}}
+
−
{{#set: gene associated=Ec-01_007700|Ec-27_003130}}
+
−
{{#set: in pathway=PHESYN|PWY-6120|PWY-3462|PWY-3461|PWY-7626|TYRSYN|PWY-6627}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 20:41, 21 March 2018

Metabolite MELIBIOSE

  • smiles:
    • C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O
  • inchi key:
    • InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N
  • common name:
    • melibiose
  • molecular weight:
    • 342.299
  • Synonym(s):
    • 6-O-(α-D-galactopyranosyl)-D-glucopyranose
    • D-Gal-α(1->6)-D-glucose
    • D-melibiose
    • 6-O-α-D-galactopyranosyl-D-glucose
    • 6-(α-D-galactosido)-D-glucose
    • α-D-Galp-(1->6)-D-Glc

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 585-99-9
  • PUBCHEM:
  • HMDB : HMDB00048
  • LIGAND-CPD:
  • CHEMSPIDER:
  • CHEBI:
  • BIGG : 45736



  • "D-Gal-&alpha;(1->6)-D-glucose" cannot be used as a page name in this wiki.
  • "&alpha;-D-Galp-(1->6)-D-Glc" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=MELIBIOSE&oldid=28691"