Difference between revisions of "MELIBIOSE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATEMUT-RXN CHORISMATEMUT-RXN] == * direction: ** REVERSIBLE * common name: ** Chorismate mut...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O * inchi key:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O |
+ | * inchi key: | ||
+ | ** InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N | ||
* common name: | * common name: | ||
− | ** | + | ** melibiose |
− | * | + | * molecular weight: |
− | + | ** 342.299 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 6-O-(α-D-galactopyranosyl)-D-glucopyranose | ||
+ | ** D-Gal-α(1->6)-D-glucose | ||
+ | ** D-melibiose | ||
+ | ** 6-O-α-D-galactopyranosyl-D-glucose | ||
+ | ** 6-(α-D-galactosido)-D-glucose | ||
+ | ** α-D-Galp-(1->6)-D-Glc | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[ALPHAGALACTOSID-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 585-99-9 |
− | ** [http:// | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11458 11458] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * HMDB : HMDB00048 |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05402 C05402] |
− | + | * CHEMSPIDER: | |
− | * | + | ** [http://www.chemspider.com/Chemical-Structure.10974.html 10974] |
− | ** [http://www. | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61827 61827] | |
− | + | * BIGG : 45736 | |
− | * | + | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O}} |
− | + | {{#set: inchi key=InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N}} | |
− | + | {{#set: common name=melibiose}} | |
− | + | {{#set: molecular weight=342.299 }} | |
− | + | {{#set: common name=6-O-(α-D-galactopyranosyl)-D-glucopyranose|D-Gal-α(1->6)-D-glucose|D-melibiose|6-O-α-D-galactopyranosyl-D-glucose|6-(α-D-galactosido)-D-glucose|α-D-Galp-(1->6)-D-Glc}} | |
− | + | {{#set: consumed by=ALPHAGALACTOSID-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite MELIBIOSE
- smiles:
- C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O
- inchi key:
- InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N
- common name:
- melibiose
- molecular weight:
- 342.299
- Synonym(s):
- 6-O-(α-D-galactopyranosyl)-D-glucopyranose
- D-Gal-α(1->6)-D-glucose
- D-melibiose
- 6-O-α-D-galactopyranosyl-D-glucose
- 6-(α-D-galactosido)-D-glucose
- α-D-Galp-(1->6)-D-Glc
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 585-99-9
- PUBCHEM:
- HMDB : HMDB00048
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 45736
- "D-Gal-α(1->6)-D-glucose" cannot be used as a page name in this wiki.
- "α-D-Galp-(1->6)-D-Glc" cannot be used as a page name in this wiki.