Difference between revisions of "Ec-21 005790"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2)) * inchi key: **...")
 
(Created page with "Category:Gene == Gene Ec-21_005790 == * left end position: ** 6704078 * transcription direction: ** POSITIVE * right end position: ** 6712979 * centisome position: ** 90.8...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] ==
+
== Gene Ec-21_005790 ==
−
* smiles:
+
* left end position:
−
** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2))
+
** 6704078
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GYOZYWVXFNDGLU-XLPZGREQSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** dTMP
+
** 6712979
−
* molecular weight:
+
* centisome position:
−
** 320.195    
+
** 90.8397    
 
* Synonym(s):
 
* Synonym(s):
−
** T
+
** Esi_0014_0093
−
** thymidylic acid
+
** Esi0014_0093
−
** thymidine monophosphate
+
** PK
−
** deoxythymidylate
+
−
** TMP
+
−
** thymidine 5'-monophosphate
+
−
** thymidine-phosphate
+
−
** thymidine 5'-phosphate
+
−
** Deoxythymidine 5'-phosphate
+
−
** 5'-Thymidylic acid
+
−
** Deoxythymidylic acid
+
−
** Thymidylate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[DTMPKI-RXN]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[THYMIDYLATESYN-RXN]]
+
*** Assignment: go-term
−
* [[RXN-14200]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
−
* [[RXN-14213]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 365-07-1
+
{{#set: left end position=6704078}}
−
* BIGG : 34753
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: right end position=6712979}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755631 16755631]
+
{{#set: centisome position=90.8397   }}
−
* HMDB : HMDB01227
+
{{#set: common name=Esi_0014_0093|Esi0014_0093|PK}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00364 C00364]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.10239189.html 10239189]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63528 63528]
+
−
* METABOLIGHTS : MTBLC63528
+
−
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2))}}
+
−
{{#set: inchi key=InChIKey=GYOZYWVXFNDGLU-XLPZGREQSA-L}}
+
−
{{#set: common name=dTMP}}
+
−
{{#set: molecular weight=320.195   }}
+
−
{{#set: common name=T|thymidylic acid|thymidine monophosphate|deoxythymidylate|TMP|thymidine 5'-monophosphate|thymidine-phosphate|thymidine 5'-phosphate|Deoxythymidine 5'-phosphate|5'-Thymidylic acid|Deoxythymidylic acid|Thymidylate}}
+
−
{{#set: consumed by=DTMPKI-RXN}}
+
−
{{#set: produced by=THYMIDYLATESYN-RXN|RXN-14200}}
+
−
{{#set: consumed or produced by=RXN-14213}}
+

Latest revision as of 19:41, 21 March 2018

Gene Ec-21_005790

  • left end position:
    • 6704078
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6712979
  • centisome position:
    • 90.8397
  • Synonym(s):
    • Esi_0014_0093
    • Esi0014_0093
    • PK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_005790&oldid=28710"