Difference between revisions of "Ec-16 001570"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14300 CPD-14300] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
 
(Created page with "Category:Gene == Gene Ec-16_001570 == * left end position: ** 1828807 * transcription direction: ** NEGATIVE * right end position: ** 1829982 * centisome position: ** 34.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14300 CPD-14300] ==
+
== Gene Ec-16_001570 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1828807
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-oxo-(11Z)-eicos-11-enoyl-CoA
+
** 1829982
−
* molecular weight:
+
* centisome position:
−
** 1069.99    
+
** 34.262375    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0047_0145
 +
** Esi0047_0145
 +
** HDC
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[HISTIDINE-DECARBOXYLASE-RXN]]
−
* [[RXN-13322]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-6173]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1828807}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581100 71581100]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1829982}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74011 74011]
+
{{#set: centisome position=34.262375    }}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0047_0145|Esi0047_0145|HDC}}
−
{{#set: inchi key=InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J}}
+
{{#set: reaction associated=HISTIDINE-DECARBOXYLASE-RXN}}
−
{{#set: common name=3-oxo-(11Z)-eicos-11-enoyl-CoA}}
+
{{#set: pathway associated=PWY-6173}}
−
{{#set: molecular weight=1069.99    }}
+
−
{{#set: produced by=RXN-13322}}
+

Latest revision as of 19:41, 21 March 2018

Gene Ec-16_001570

  • left end position:
    • 1828807
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1829982
  • centisome position:
    • 34.262375
  • Synonym(s):
    • Esi_0047_0145
    • Esi0047_0145
    • HDC

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_001570&oldid=28719"