Difference between revisions of "RXN-16616"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] == * smiles: ** CC1(C(O)C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16616 RXN-16616] == * direction: ** LEFT-TO-RIGHT * common name: ** NAD(P)-binding domain * ec...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16616 RXN-16616] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** NAD(P)-binding domain |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[NADPH]][c] '''+''' 1 [[5Z-3-oxo-tetradec-5-enoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 NADPH[c] '''+''' 1 a (5Z)-3-oxo-tetradec-5-enoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R,5Z)-3-hydroxy-tetradec-5-enoyl-[acp][c] |
| − | == | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Ec-01_007100]] |
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664] | ||
| + | ** '''10''' reactions found over '''14''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=NAD(P)-binding domain}} | |
| − | + | {{#set: ec number=EC-1.1.1.100}} | |
| − | + | {{#set: gene associated=Ec-01_007100}} | |
| − | + | {{#set: in pathway=PWY-7664}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:41, 21 March 2018
Contents
Reaction RXN-16616
- direction:
- LEFT-TO-RIGHT
- common name:
- NAD(P)-binding domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADPH[c] + 1 5Z-3-oxo-tetradec-5-enoyl-ACPs[c] + 1 PROTON[c] => 1 NADP[c] + 1 3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs[c]
- With common name(s):
- 1 NADPH[c] + 1 a (5Z)-3-oxo-tetradec-5-enoyl-[acp][c] + 1 H+[c] => 1 NADP+[c] + 1 a (3R,5Z)-3-hydroxy-tetradec-5-enoyl-[acp][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-01_007100
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY-7664, oleate biosynthesis IV (anaerobic): PWY-7664
- 10 reactions found over 14 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
