Difference between revisions of "Ec-09 002160"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * in...") |
(Created page with "Category:Gene == Gene Ec-09_002160 == * left end position: ** 2531774 * transcription direction: ** NEGATIVE * right end position: ** 2549731 * centisome position: ** 45.1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-09_002160 == |
− | * | + | * left end position: |
− | ** | + | ** 2531774 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2549731 |
− | * | + | * centisome position: |
− | ** | + | ** 45.104248 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0074_0087 |
− | ** | + | ** Esi0074_0087 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ATPASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2531774}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2549731}} | |
− | + | {{#set: centisome position=45.104248 }} | |
− | + | {{#set: common name=Esi_0074_0087|Esi0074_0087}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:42, 21 March 2018
Gene Ec-09_002160
- left end position:
- 2531774
- transcription direction:
- NEGATIVE
- right end position:
- 2549731
- centisome position:
- 45.104248
- Synonym(s):
- Esi_0074_0087
- Esi0074_0087
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome