Difference between revisions of "CPD-318"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-22_003850 == * left end position: ** 4320423 * transcription direction: ** POSITIVE * right end position: ** 4335783 * centisome position: ** 95.6...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=LHFJO...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-22_003850 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] ==
−
* left end position:
+
* smiles:
−
** 4320423
+
** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
−
* right end position:
+
* common name:
−
** 4335783
+
** monodehydroascorbate radical
−
* centisome position:
+
* molecular weight:
−
** 95.6724    
+
** 175.118    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0039_0037
+
** monodehydroascorbic acid
−
** Esi0039_0037
+
** semidehydroascorbic acid
−
** MDAR-like
+
** semidehydroascorbate
 +
** ascorbyl radical
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
 +
* [[RXN-3523]]
 
* [[1.6.5.4-RXN]]
 
* [[1.6.5.4-RXN]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
* [[RXN-10981]]
−
** [[pantograph]]-[[aragem]]
+
* [[RXN-3521]]
−
** [[pantograph]]-[[aragem]]
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-6370]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4320423}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5483640 5483640]
−
{{#set: right end position=4335783}}
+
* CHEBI:
−
{{#set: centisome position=95.6724   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16504 16504]
−
{{#set: common name=Esi_0039_0037|Esi0039_0037|MDAR-like}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=1.6.5.4-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01041 C01041]
−
{{#set: pathway associated=PWY-6370}}
+
{{#set: smiles=C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)}}
 +
{{#set: inchi key=InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N}}
 +
{{#set: common name=monodehydroascorbate radical}}
 +
{{#set: molecular weight=175.118   }}
 +
{{#set: common name=monodehydroascorbic acid|semidehydroascorbic acid|semidehydroascorbate|ascorbyl radical}}
 +
{{#set: consumed by=RXN-3523|1.6.5.4-RXN}}
 +
{{#set: produced by=RXN-10981|RXN-3521}}

Latest revision as of 20:42, 21 March 2018

Metabolite CPD-318

  • smiles:
    • C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
  • inchi key:
    • InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
  • common name:
    • monodehydroascorbate radical
  • molecular weight:
    • 175.118
  • Synonym(s):
    • monodehydroascorbic acid
    • semidehydroascorbic acid
    • semidehydroascorbate
    • ascorbyl radical

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-318&oldid=28795"