Difference between revisions of "RXN-14576"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE] == * smiles: ** C1(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14576 RXN-14576] == * direction: ** LEFT-TO-RIGHT * common name: ** Acyl-CoA oxidase/dehydrogen...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14576 RXN-14576] ==
−
* smiles:
+
* direction:
−
** C1(CC(=NC(C1)C([O-])=O)C([O-])=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CXMBCXQHOXUCEO-BYPYZUCNSA-L
+
 
* common name:
 
* common name:
−
** (S)-2,3,4,5-tetrahydrodipicolinate
+
** Acyl-CoA oxidase/dehydrogenase, central domain
−
* molecular weight:
+
** acyl-CoA oxidase, partial
−
** 169.137   
+
** acyl-CoA oxidase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
−
** 2,3,4,5-tetrahydrodipicolinate
 
−
** (S)-2,3,4,5-tetrahydropyridine-2,6-dicarboxylate
 
−
** Δ1-piperideine-2,6-dicarboxylate
 
−
** tetrahydrodipicolinate
 
−
** tetrahydropyridine-2,6-dicarboxylate
 
−
** L-2,3,4,5-tetrahydrodipicolinate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14014]]
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-15436]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD0-1162]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-7737]]
+
** 1 oxygen[c] '''+''' 1 (5Z)-tetradecenoyl-CoA[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 (2E,5Z)-tetradecenoyl-CoA[c]
−
* [[RXN-4821]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-22_002920]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-26_004320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-08_006390]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7291]], oleate β-oxidation (isomerase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7291 PWY-7291]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 52-52-8
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Acyl-CoA oxidase/dehydrogenase, central domain}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460405 5460405]
+
{{#set: common name=acyl-CoA oxidase, partial}}
−
* HMDB : HMDB12289
+
{{#set: common name=acyl-CoA oxidase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.3.3.6}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03972 C03972]
+
{{#set: gene associated=Ec-22_002920|Ec-26_004320|Ec-08_006390}}
−
* CHEMSPIDER:
+
{{#set: in pathway=PWY-7291}}
−
** [http://www.chemspider.com/Chemical-Structure.4573939.html 4573939]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16845 16845]
+
{{#set: reconstruction tool=pathwaytools}}
−
* BIGG : 42888
+
−
{{#set: smiles=C1(CC(=NC(C1)C([O-])=O)C([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=CXMBCXQHOXUCEO-BYPYZUCNSA-L}}
+
−
{{#set: common name=(S)-2,3,4,5-tetrahydrodipicolinate}}
+
−
{{#set: molecular weight=169.137    }}
+
−
{{#set: common name=2,3,4,5-tetrahydrodipicolinate|(S)-2,3,4,5-tetrahydropyridine-2,6-dicarboxylate|Δ1-piperideine-2,6-dicarboxylate|tetrahydrodipicolinate|tetrahydropyridine-2,6-dicarboxylate|L-2,3,4,5-tetrahydrodipicolinate}}
+
−
{{#set: produced by=RXN-14014}}
+
−
{{#set: reversible reaction associated=RXN-7737|RXN-4821}}
+

Latest revision as of 19:42, 21 March 2018

Reaction RXN-14576

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Acyl-CoA oxidase/dehydrogenase, central domain
    • acyl-CoA oxidase, partial
    • acyl-CoA oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7291, oleate β-oxidation (isomerase-dependent, yeast): PWY-7291
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14576&oldid=28829"