Difference between revisions of "CPD-12303"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-483 RXN66-483] == * direction: ** LEFT-TO-RIGHT * common name: ** long chain acyl-coA synthet...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12303 CPD-12303] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-483 RXN66-483] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12303 CPD-12303] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C
 +
* inchi key:
 +
** InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K
 
* common name:
 
* common name:
−
** long chain acyl-coA synthetase
+
** undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine
−
** long chain acyl-CoA synthetase
+
* molecular weight:
−
* ec number:
+
** 1598.955   
−
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol
 +
** lipid I (tetrapeptide)
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CO-A]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[2-Me-Branched-234-Sat-FA]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[2-Me-Branched-234-Sat-Fatty-Acyl-CoA]][c] '''+''' 1 [[PPI]][c]
+
* [[RXN-11347]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 coenzyme A[c] '''+''' 1 ATP[c] '''+''' 1 a 2-methyl branched 2,3,4-saturated fatty acid[c] '''=>''' 1 AMP[c] '''+''' 1 a 2-methyl branched 2,3,4-saturated fatty acyl-CoA[c] '''+''' 1 diphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-12_008720]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-03_003710]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-02_006430]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-01_001560]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY66-387]], fatty acid α-oxidation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-387 PWY66-387]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=long chain acyl-coA synthetase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657616 90657616]
−
{{#set: common name=long chain acyl-CoA synthetase}}
+
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C}}
−
{{#set: ec number=EC-6.2.1.3}}
+
{{#set: inchi key=InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K}}
−
{{#set: gene associated=Ec-12_008720|Ec-03_003710|Ec-02_006430|Ec-01_001560}}
+
{{#set: common name=undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine}}
−
{{#set: in pathway=PWY66-387}}
+
{{#set: molecular weight=1598.955    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol|lipid I (tetrapeptide)}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: produced by=RXN-11347}}
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:42, 21 March 2018

Metabolite CPD-12303

  • smiles:
    • CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C
  • inchi key:
    • InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K
  • common name:
    • undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine
  • molecular weight:
    • 1598.955
  • Synonym(s):
    • mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol
    • lipid I (tetrapeptide)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-12303&oldid=28855"