Difference between revisions of "S-ubiquitinyl-UAP-E1-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TRYPTOPHAN D-TRYPTOPHAN] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * inchi key...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-UAP-E1-L-cysteine S-ubiquitinyl-UAP-E1-L-cysteine] == * common name: ** an S-ubiq...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TRYPTOPHAN D-TRYPTOPHAN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-UAP-E1-L-cysteine S-ubiquitinyl-UAP-E1-L-cysteine] ==
−
* smiles:
+
−
** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))
+
−
* inchi key:
+
−
** InChIKey=QIVBCDIJIAJPQS-SECBINFHSA-N
+
 
* common name:
 
* common name:
−
** D-tryptophan
+
** an S-ubiquitinyl-[E1 ubiquitin-activating enzyme]-L-cysteine
−
* molecular weight:
+
−
** 204.228   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** an S-ubiquitinyl-[ubiquitin-activating enzyme E1]-L-cysteine
 +
** an S-ubiquitinyl-[ubiquitin-activating E1 enzyme]-L-cysteine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-8664]]
+
* [[RXN-15563]]
 +
* [[RXN-15556]]
 +
* [[RXN-16314]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: common name=an S-ubiquitinyl-[E1 ubiquitin-activating enzyme]-L-cysteine}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=97942 97942]
+
{{#set: common name=an S-ubiquitinyl-[ubiquitin-activating enzyme E1]-L-cysteine|an S-ubiquitinyl-[ubiquitin-activating E1 enzyme]-L-cysteine}}
−
* CAS : 153-94-6
+
{{#set: consumed by=RXN-15563|RXN-15556|RXN-16314}}
−
* PUBCHEM:
+
{{#set: produced by=UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6923517 6923517]
+
−
* HMDB : HMDB13609
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00525 C00525]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57719 57719]
+
−
* METABOLIGHTS : MTBLC57719
+
−
{{#set: smiles=C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))}}
+
−
{{#set: inchi key=InChIKey=QIVBCDIJIAJPQS-SECBINFHSA-N}}
+
−
{{#set: common name=D-tryptophan}}
+
−
{{#set: molecular weight=204.228    }}
+
−
{{#set: consumed by=RXN-8664}}
+

Latest revision as of 19:42, 21 March 2018

Metabolite S-ubiquitinyl-UAP-E1-L-cysteine

  • common name:
    • an S-ubiquitinyl-[E1 ubiquitin-activating enzyme]-L-cysteine
  • Synonym(s):
    • an S-ubiquitinyl-[ubiquitin-activating enzyme E1]-L-cysteine
    • an S-ubiquitinyl-[ubiquitin-activating E1 enzyme]-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an S-ubiquitinyl-[E1 ubiquitin-activating enzyme]-L-cysteine" cannot be used as a page name in this wiki.
  • "an S-ubiquitinyl-[ubiquitin-activating enzyme E1]-L-cysteine" cannot be used as a page name in this wiki.
  • "an S-ubiquitinyl-[ubiquitin-activating E1 enzyme]-L-cysteine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=S-ubiquitinyl-UAP-E1-L-cysteine&oldid=28861"