Difference between revisions of "CPD-35"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16024 RXN-16024] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycerol-3-phosphate O-acyl...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-35 CPD-35] == * smiles: ** CC(=O)NCCCC(=O)[O-] * inchi key: ** InChIKey=UZTFMUBKZQVKLK-UHFF...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16024 RXN-16024] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-35 CPD-35] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)NCCCC(=O)[O-]
 +
* inchi key:
 +
** InChIKey=UZTFMUBKZQVKLK-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** Glycerol-3-phosphate O-acyltransferase
+
** 4-acetamidobutanoate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.15 EC-2.3.1.15]
+
** 144.15  
 
* Synonym(s):
 
* Synonym(s):
 +
** N-acetyl-4-aminobutyrate
 +
** N-acetyl-γ-aminobutyrate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Stearoyl-ACPs]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[CPD0-2113]][c] '''+''' 1 [[ACP]][c]
+
* [[RXN-37]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a stearoyl-[acp][c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 1-stearoyl-sn-glycerol 3-phosphate[c] '''+''' 1 a holo-[acyl-carrier protein][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_003960]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7587]], oleate biosynthesis III (cyanobacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7587 PWY-7587]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Glycerol-3-phosphate O-acyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991994 6991994]
−
{{#set: ec number=EC-2.3.1.15}}
+
* HMDB : HMDB03681
−
{{#set: gene associated=Ec-01_003960}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-7587}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02946 C02946]
−
{{#set: reconstruction category=annotation}}
+
* CHEMSPIDER:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.chemspider.com/Chemical-Structure.5360158.html 5360158]
−
{{#set: reconstruction source=esiliculosus_genome}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11951 11951]
 +
* METABOLIGHTS : MTBLC11951
 +
{{#set: smiles=CC(=O)NCCCC(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=UZTFMUBKZQVKLK-UHFFFAOYSA-M}}
 +
{{#set: common name=4-acetamidobutanoate}}
 +
{{#set: molecular weight=144.15    }}
 +
{{#set: common name=N-acetyl-4-aminobutyrate|N-acetyl-γ-aminobutyrate}}
 +
{{#set: produced by=RXN-37}}

Latest revision as of 19:42, 21 March 2018

Metabolite CPD-35

  • smiles:
    • CC(=O)NCCCC(=O)[O-]
  • inchi key:
    • InChIKey=UZTFMUBKZQVKLK-UHFFFAOYSA-M
  • common name:
    • 4-acetamidobutanoate
  • molecular weight:
    • 144.15
  • Synonym(s):
    • N-acetyl-4-aminobutyrate
    • N-acetyl-γ-aminobutyrate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCCC(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-35&oldid=28882"