Difference between revisions of "Ec-06 004220"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == * smiles: ** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O * common name: **...") |
(Created page with "Category:Gene == Gene Ec-06_004220 == * left end position: ** 3514846 * transcription direction: ** POSITIVE * right end position: ** 3518351 * centisome position: ** 40.1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_004220 == |
− | * | + | * left end position: |
− | ** | + | ** 3514846 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3518351 |
− | * | + | * centisome position: |
− | ** | + | ** 40.134083 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0062_0101 |
− | ** | + | ** Esi0062_0101 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.2.1.113-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | == | + | == Pathways associated == |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3514846}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3518351}} | |
− | + | {{#set: centisome position=40.134083 }} | |
− | + | {{#set: common name=Esi_0062_0101|Esi0062_0101}} | |
− | + | {{#set: reaction associated=3.2.1.113-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:43, 21 March 2018
Gene Ec-06_004220
- left end position:
- 3514846
- transcription direction:
- POSITIVE
- right end position:
- 3518351
- centisome position:
- 40.134083
- Synonym(s):
- Esi_0062_0101
- Esi0062_0101
Reactions associated
- Reaction: 3.2.1.113-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome