Difference between revisions of "D-GALACTONATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10279/NAD//CPD-14281/NADH/PROTON.37. TRANS-2-ENOYL-COA-RED...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONATE D-GALACTONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InCh...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONATE D-GALACTONATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=RGHNJXZEOKUKBD-MGCNEYSASA-M | ||
+ | * common name: | ||
+ | ** D-galactonate | ||
+ | * molecular weight: | ||
+ | ** 195.149 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** galactonate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[GALACTONOLACTONASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5461127 5461127] |
− | {{#set: | + | * HMDB : HMDB00565 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00880 C00880] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4574468.html 4574468] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12931 12931] | ||
+ | * BIGG : 36277 | ||
+ | {{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-MGCNEYSASA-M}} | ||
+ | {{#set: common name=D-galactonate}} | ||
+ | {{#set: molecular weight=195.149 }} | ||
+ | {{#set: common name=galactonate}} | ||
+ | {{#set: produced by=GALACTONOLACTONASE-RXN}} |
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite D-GALACTONATE
- smiles:
- C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-MGCNEYSASA-M
- common name:
- D-galactonate
- molecular weight:
- 195.149
- Synonym(s):
- galactonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.