Difference between revisions of "Ec-23 003760"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == * smiles: ** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O * common name: **...") |
(Created page with "Category:Gene == Gene Ec-23_003760 == * left end position: ** 4096723 * transcription direction: ** NEGATIVE * right end position: ** 4102454 * centisome position: ** 84.6...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-23_003760 == |
− | * | + | * left end position: |
− | ** | + | ** 4096723 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4102454 |
− | * | + | * centisome position: |
− | ** | + | ** 84.65236 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0118_0048 |
− | ** | + | ** Esi0118_0048 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | == | + | == Pathways associated == |
− | * [[ | + | * [[PWY-1801]] |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4096723}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4102454}} | |
− | + | {{#set: centisome position=84.65236 }} | |
− | + | {{#set: common name=Esi_0118_0048|Esi0118_0048}} | |
− | + | {{#set: reaction associated=S-FORMYLGLUTATHIONE-HYDROLASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-1801}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:43, 21 March 2018
Gene Ec-23_003760
- left end position:
- 4096723
- transcription direction:
- NEGATIVE
- right end position:
- 4102454
- centisome position:
- 84.65236
- Synonym(s):
- Esi_0118_0048
- Esi0118_0048
Reactions associated
- Reaction: S-FORMYLGLUTATHIONE-HYDROLASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome