Difference between revisions of "RXN-15006"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOENE PHYTOENE] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15006 RXN-15006] == * direction: ** LEFT-TO-RIGHT * common name: ** N-acetyl-gamma-glutamyl-pho...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOENE PHYTOENE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15006 RXN-15006] ==
* smiles:
+
* direction:
** CC(=CCCC(=CCCC(=CCCC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=YVLPJIGOMTXXLP-KEKOKYSKSA-N
+
 
* common name:
 
* common name:
** all-trans-phytoene
+
** N-acetyl-gamma-glutamyl-phosphate reductase, C-terminal part
* molecular weight:
+
* ec number:
** 544.946   
+
** [http://enzyme.expasy.org/EC/1.2.1.38 EC-1.2.1.38]
 
* Synonym(s):
 
* Synonym(s):
** 7,7',8,8',11,11',12,12'-octahydro-ψ,ψ-caro
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[LysW-L-glutamate-5-phosphate]][c] '''=>''' 1 [[LysW-L-glutamate-5-semialdehyde]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[Pi]][c]
* [[RXN1F-144]]
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 an [L-2-aminoadipate carrier protein]-L-glutamate 5-phosphate[c] '''=>''' 1 an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde[c] '''+''' 1 NADP+[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_003520]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7400]], L-arginine biosynthesis IV (archaebacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7400 PWY-7400]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 540-04-5
+
{{#set: direction=LEFT-TO-RIGHT}}
* LIPID_MAPS : LMPR01070254
+
{{#set: common name=N-acetyl-gamma-glutamyl-phosphate reductase, C-terminal part}}
* PUBCHEM:
+
{{#set: ec number=EC-1.2.1.38}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280784 5280784]
+
{{#set: gene associated=Ec-21_003520}}
* HMDB : HMDB02181
+
{{#set: in pathway=PWY-7400}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C05413 C05413]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.chemspider.com/Chemical-Structure.4444344.html 4444344]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=8191 8191]
+
* METABOLIGHTS : MTBLC8191
+
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=YVLPJIGOMTXXLP-KEKOKYSKSA-N}}
+
{{#set: common name=all-trans-phytoene}}
+
{{#set: molecular weight=544.946    }}
+
{{#set: common name=7,7',8,8',11,11',12,12'-octahydro-ψ,ψ-caro}}
+
{{#set: consumed or produced by=RXN1F-144}}
+

Latest revision as of 19:43, 21 March 2018

Reaction RXN-15006

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • N-acetyl-gamma-glutamyl-phosphate reductase, C-terminal part
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7400, L-arginine biosynthesis IV (archaebacteria): PWY-7400
    • 7 reactions found over 9 reactions in the full pathway

Reconstruction information

External links