Difference between revisions of "RXN-9787"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] == * smiles: ** C(C1(CCCC=N1))([O-])=O * inchi key: ** InChIKey=CSDPVAKVEWET...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9787 RXN-9787] == * direction: ** REVERSIBLE * common name: ** cysteine:[ThiI sulfur-carrier pr...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9787 RXN-9787] ==
−
* smiles:
+
* direction:
−
** C(C1(CCCC=N1))([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M
+
 
* common name:
 
* common name:
−
** 1-piperideine 6-carboxylate
+
** cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase
−
* molecular weight:
+
** Aminotransferase class V domain
−
** 126.135   
+
** Cysteine desulfurase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
 
* Synonym(s):
 
* Synonym(s):
−
** Δ1-piperideine-6-carboxylate
 
−
** Δ6-piperideine-2-carboxylate
 
−
** 1,6-didehydropiperidine-2-carboxylate
 
−
** 2,3,4,5-tetrahydropyridine-2-carboxylate
 
−
** (S)-2,3,4,5-tetrahydropiperidine-2-carboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10855]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CYS]][c] '''+''' 1 [[Sulfur-Carrier-Proteins-ThiI]][c] '''<=>''' 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[Sulfurylated-ThiI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-8173]]
+
** 1 L-cysteine[c] '''+''' 1 a ThiI sulfur-carrier protein[c] '''<=>''' 1 L-alanine[c] '''+''' 1 an S-sulfanyl-[ThiI sulfur-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-22_000950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-21_005640]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-21_003740]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00450 C00450]
+
{{#set: common name=cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase}}
−
* CHEBI:
+
{{#set: common name=Aminotransferase class V domain}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58769 58769]
+
{{#set: common name=Cysteine desulfurase}}
−
* METABOLIGHTS : MTBLC58769
+
{{#set: ec number=EC-2.8.1.7}}
−
* PUBCHEM:
+
{{#set: gene associated=Ec-22_000950|Ec-21_005640|Ec-21_003740}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266761 45266761]
+
{{#set: in pathway=}}
−
* HMDB : HMDB59657
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C(C1(CCCC=N1))([O-])=O}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: inchi key=InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=1-piperideine 6-carboxylate}}
+
−
{{#set: molecular weight=126.135    }}
+
−
{{#set: common name=&Delta;1-piperideine-6-carboxylate|&Delta;6-piperideine-2-carboxylate|1,6-didehydropiperidine-2-carboxylate|2,3,4,5-tetrahydropyridine-2-carboxylate|(S)-2,3,4,5-tetrahydropiperidine-2-carboxylate}}
+
−
{{#set: consumed by=RXN-10855}}
+
−
{{#set: reversible reaction associated=RXN-8173}}
+

Latest revision as of 20:43, 21 March 2018

Reaction RXN-9787

  • direction:
    • REVERSIBLE
  • common name:
    • cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase
    • Aminotransferase class V domain
    • Cysteine desulfurase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase" cannot be used as a page name in this wiki.





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-9787&oldid=28925"