Difference between revisions of "Ec-10 003280"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] == * smiles: ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
 
(Created page with "Category:Gene == Gene Ec-10_003280 == * left end position: ** 3334075 * transcription direction: ** POSITIVE * right end position: ** 3334458 * centisome position: ** 51.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] ==
+
== Gene Ec-10_003280 ==
* smiles:
+
* left end position:
** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3334075
* inchi key:
+
* transcription direction:
** InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J
+
** POSITIVE
* common name:
+
* right end position:
** 2-trans, 4-cis-undecadienoyl-CoA
+
** 3334458
* molecular weight:
+
* centisome position:
** 927.749    
+
** 51.28569    
 
* Synonym(s):
 
* Synonym(s):
** 2E, 4Z-undecadienoyl-CoA
+
** Esi_0117_0015
 +
** Esi0117_0015
 +
** AIR carboxylase
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14776]]
+
* Reaction: [[AIRCARBOXY-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[RXN-14775]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-6124]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=3334075}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658228 90658228]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=3334458}}
{{#set: inchi key=InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J}}
+
{{#set: centisome position=51.28569   }}
{{#set: common name=2-trans, 4-cis-undecadienoyl-CoA}}
+
{{#set: common name=Esi_0117_0015|Esi0117_0015|AIR carboxylase}}
{{#set: molecular weight=927.749   }}
+
{{#set: reaction associated=AIRCARBOXY-RXN}}
{{#set: common name=2E, 4Z-undecadienoyl-CoA}}
+
{{#set: pathway associated=PWY-6124}}
{{#set: consumed by=RXN-14776}}
+
{{#set: produced by=RXN-14775}}
+

Latest revision as of 20:43, 21 March 2018

Gene Ec-10_003280

  • left end position:
    • 3334075
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3334458
  • centisome position:
    • 51.28569
  • Synonym(s):
    • Esi_0117_0015
    • Esi0117_0015
    • AIR carboxylase

Reactions associated

Pathways associated

External links