Difference between revisions of "CANAVANINOSUCCINATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16096 RXN-16096] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] == * smiles: ** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16096 RXN-16096] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/4.2.1.134 EC-4.2.1.134]
+
** InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M
 +
* common name:
 +
** canavaninosuccinate
 +
* molecular weight:
 +
** 291.24   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-22]]
−
** 1 [[CPD-17347]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-17348]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-10]]
−
** 1 (3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA[c] '''=>''' 1 H2O[c] '''+''' 1 (2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7601]], arachidonate biosynthesis IV (8-detaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7601 PWY-7601]
+
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7725]], arachidonate biosynthesis V (8-detaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7725 PWY-7725]
+
−
** '''5''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6598]], sciadonate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6598 PWY-6598]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[gap-filling]]
+
−
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
*** Tool: [[meneco]]
+
−
**** Comment: [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-4.2.1.134}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820246 91820246]
−
{{#set: in pathway=PWY-7601|PWY-7725|PWY-6598}}
+
* HMDB : HMDB12197
−
{{#set: reconstruction category=gap-filling}}
+
{{#set: smiles=C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O}}
−
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
+
{{#set: inchi key=InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M}}
−
{{#set: reconstruction tool=meneco}}
+
{{#set: common name=canavaninosuccinate}}
−
{{#set: reconstruction comment=added for gapfilling}}
+
{{#set: molecular weight=291.24    }}
 +
{{#set: consumed by=RXN-22}}
 +
{{#set: produced by=RXN-10}}

Latest revision as of 19:43, 21 March 2018

Metabolite CANAVANINOSUCCINATE

  • smiles:
    • C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O
  • inchi key:
    • InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M
  • common name:
    • canavaninosuccinate
  • molecular weight:
    • 291.24
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CANAVANINOSUCCINATE&oldid=28948"