Difference between revisions of "RXN-17018"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17018 RXN-17018] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycerol-3-phosphate O-acyl...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17018 RXN-17018] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J
+
 
* common name:
 
* common name:
−
** benzoyl-CoA
+
** Glycerol-3-phosphate O-acyltransferase
−
* molecular weight:
+
* ec number:
−
** 867.61   
+
** [http://enzyme.expasy.org/EC/2.3.1.15 EC-2.3.1.15]
 
* Synonym(s):
 
* Synonym(s):
−
** S-benzoate coenzyme A
 
−
** benzoyl-S-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-2006]]
+
** 1 [[GLYCEROL-3P]][c] '''+''' 1 [[Palmitoyl-ACPs]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[1-PALMITOYLGLYCEROL-3-PHOSPHATE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 sn-glycerol 3-phosphate[c] '''+''' 1 a palmitoyl-[acp][c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 1-palmitoylglycerol 3-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_003960]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 102185-37-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Glycerol-3-phosphate O-acyltransferase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266596 45266596]
+
{{#set: ec number=EC-2.3.1.15}}
−
* CHEBI:
+
{{#set: gene associated=Ec-01_003960}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57369 57369]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00512 C00512]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* HMDB : HMDB02252
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J}}
+
−
{{#set: common name=benzoyl-CoA}}
+
−
{{#set: molecular weight=867.61    }}
+
−
{{#set: common name=S-benzoate coenzyme A|benzoyl-S-CoA}}
+
−
{{#set: produced by=RXN-2006}}
+

Latest revision as of 19:43, 21 March 2018

Reaction RXN-17018

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glycerol-3-phosphate O-acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-17018&oldid=28955"