Difference between revisions of "Ec-06 000030"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-170 CPD-170] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OCC4(C(O)C(O)C(O)C(OCC3(C(O)C(O)C(O)C(...")
 
(Created page with "Category:Gene == Gene Ec-06_000030 == * left end position: ** 48662 * transcription direction: ** NEGATIVE * right end position: ** 51590 * centisome position: ** 0.555644...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-170 CPD-170] ==
+
== Gene Ec-06_000030 ==
* smiles:
+
* left end position:
** C(O)C1(C(O)C(O)C(O)C(O1)OCC4(C(O)C(O)C(O)C(OCC3(C(O)C(O)C(O)C(OC2(CO)(C(O)C(O)C(CO)O2))O3))O4))
+
** 48662
* inchi key:
+
* transcription direction:
** InChIKey=UQZIYBXSHAGNOE-XNSRJBNMSA-N
+
** NEGATIVE
* common name:
+
* right end position:
** stachyose
+
** 51590
* molecular weight:
+
* centisome position:
** 666.583    
+
** 0.5556445    
 
* Synonym(s):
 
* Synonym(s):
** (2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6R)-6-[(2R,3R,4S,5R,6R)-6-[(2S,3S,4R,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxy-oxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
+
** Esi_0085_0119
** α-D-Galp-(1->6)-α-D-Galp-(1->6)-α-D-Glcp-(1->2)-β-D-Fruf
+
** Esi0085_0119
 +
** PK
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-11501]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
* [[2.4.1.67-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* CAS : 10094-58-3
+
{{#set: left end position=48662}}
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439531 439531]
+
{{#set: right end position=51590}}
* KEGG-GLYCAN : G00278
+
{{#set: centisome position=0.5556445   }}
* HMDB : HMDB03553
+
{{#set: common name=Esi_0085_0119|Esi0085_0119|PK}}
* LIGAND-CPD:
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C01613 C01613]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.388624.html 388624]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17164 17164]
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OCC4(C(O)C(O)C(O)C(OCC3(C(O)C(O)C(O)C(OC2(CO)(C(O)C(O)C(CO)O2))O3))O4))}}
+
{{#set: inchi key=InChIKey=UQZIYBXSHAGNOE-XNSRJBNMSA-N}}
+
{{#set: common name=stachyose}}
+
{{#set: molecular weight=666.583   }}
+
{{#set: common name=(2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6R)-6-[(2R,3R,4S,5R,6R)-6-[(2S,3S,4R,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxy-oxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol|α-D-Galp-(1->6)-α-D-Galp-(1->6)-α-D-Glcp-(1->2)-β-D-Fruf}}
+
{{#set: consumed by=RXN-11501}}
+
{{#set: consumed or produced by=2.4.1.67-RXN}}
+

Latest revision as of 19:43, 21 March 2018

Gene Ec-06_000030

  • left end position:
    • 48662
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 51590
  • centisome position:
    • 0.5556445
  • Synonym(s):
    • Esi_0085_0119
    • Esi0085_0119
    • PK

Reactions associated

Pathways associated

External links