Difference between revisions of "CPD-316"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_003690 == * left end position: ** 3046375 * transcription direction: ** NEGATIVE * right end position: ** 3051869 * centisome position: ** 34.7...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-06_003690 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] ==
* left end position:
+
* smiles:
** 3046375
+
** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N
* right end position:
+
* common name:
** 3051869
+
** reduced riboflavin
* centisome position:
+
* molecular weight:
** 34.784874    
+
** 378.384    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0246_0031
+
** 4a,5-dihydroriboflavine
** Esi0246_0031
+
** 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine
** OAT, ArgJ
+
** 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[RXN-12445]]
***automated-name-match
+
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[ARGSYNBSUB-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3046375}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480537 45480537]
{{#set: right end position=3051869}}
+
* HMDB : HMDB01557
{{#set: centisome position=34.784874   }}
+
* LIGAND-CPD:
{{#set: common name=Esi_0246_0031|Esi0246_0031|OAT, ArgJ}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01007 C01007]
{{#set: reaction associated=GLUTAMATE-N-ACETYLTRANSFERASE-RXN}}
+
* CHEMSPIDER:
{{#set: pathway associated=ARGSYNBSUB-PWY}}
+
** [http://www.chemspider.com/Chemical-Structure.52885.html 52885]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=8798 8798]
 +
* BIGG : 36596
 +
{{#set: smiles=CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)}}
 +
{{#set: inchi key=InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N}}
 +
{{#set: common name=reduced riboflavin}}
 +
{{#set: molecular weight=378.384   }}
 +
{{#set: common name=4a,5-dihydroriboflavine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione}}
 +
{{#set: produced by=RXN-12445|NADPH-DEHYDROGENASE-FLAVIN-RXN}}

Latest revision as of 20:44, 21 March 2018

Metabolite CPD-316

  • smiles:
    • CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)
  • inchi key:
    • InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N
  • common name:
    • reduced riboflavin
  • molecular weight:
    • 378.384
  • Synonym(s):
    • 4a,5-dihydroriboflavine
    • 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine
    • 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



"7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione" cannot be used as a page name in this wiki.