Difference between revisions of "TRNA-Containing-5MeAminoMe-2-ThioU"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5MeAminoMe-2-ThioU tRNA-Containing-5MeAminoMe-2-ThioU] == * common name: ** a 5...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5MeAminoMe-2-ThioU tRNA-Containing-5MeAminoMe-2-ThioU] ==
* smiles:
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
+
 
* common name:
 
* common name:
** isofucosterol
+
** a 5-methylaminomethyl-2-thiouridine in tRNA
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a 5-methylaminomethyl-2-thiouridylate in tRNA
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4210]]
+
* [[RXN0-5144]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 5-methylaminomethyl-2-thiouridine in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244964 25244964]
+
{{#set: common name=a 5-methylaminomethyl-2-thiouridylate in tRNA}}
* LIGAND-CPD:
+
{{#set: produced by=RXN0-5144}}
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
+
* HMDB : HMDB02374
+
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
+
{{#set: common name=isofucosterol}}
+
{{#set: molecular weight=412.698    }}
+
{{#set: produced by=RXN-4210}}
+

Latest revision as of 19:44, 21 March 2018

Metabolite tRNA-Containing-5MeAminoMe-2-ThioU

  • common name:
    • a 5-methylaminomethyl-2-thiouridine in tRNA
  • Synonym(s):
    • a 5-methylaminomethyl-2-thiouridylate in tRNA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links