Difference between revisions of "4-PRENYLPHLORISOBUTYROPHENONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-21-CP-39-keto-40-Me-C60-ACPs cis-21-CP-39-keto-40-Me-C60-ACPs] == * common name: ** a cis-k...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PRENYLPHLORISOBUTYROPHENONE 4-PRENYLPHLORISOBUTYROPHENONE] == * smiles: ** CC(=CCC1(=C(C=C(C(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PRENYLPHLORISOBUTYROPHENONE 4-PRENYLPHLORISOBUTYROPHENONE] == |
+ | * smiles: | ||
+ | ** CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C | ||
+ | * inchi key: | ||
+ | ** InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 4-prenylphlorisobutyrophenone |
+ | * molecular weight: | ||
+ | ** 263.313 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** compound co-X | ||
+ | ** PPIBP | ||
+ | ** dimethylallyl-phlorisobutyrophenone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7813]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203134 25203134] |
+ | {{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C}} | ||
+ | {{#set: inchi key=InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=4-prenylphlorisobutyrophenone}} | ||
+ | {{#set: molecular weight=263.313 }} | ||
+ | {{#set: common name=compound co-X|PPIBP|dimethylallyl-phlorisobutyrophenone}} | ||
+ | {{#set: consumed by=RXN-7813}} |
Latest revision as of 19:44, 21 March 2018
Contents
Metabolite 4-PRENYLPHLORISOBUTYROPHENONE
- smiles:
- CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C
- inchi key:
- InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M
- common name:
- 4-prenylphlorisobutyrophenone
- molecular weight:
- 263.313
- Synonym(s):
- compound co-X
- PPIBP
- dimethylallyl-phlorisobutyrophenone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C" cannot be used as a page name in this wiki.