Difference between revisions of "2E-9Z-octadeca-2-9-dienoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2E-9Z-octadeca-2-9-dienoyl-ACPs 2E-9Z-octadeca-2-9-dienoyl-ACPs] == * common name: ** a (2E,9Z)...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2E-9Z-octadeca-2-9-dienoyl-ACPs 2E-9Z-octadeca-2-9-dienoyl-ACPs] ==
* smiles:
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
+
 
* common name:
 
* common name:
** 6-oxocampestanol
+
** a (2E,9Z)-octadeca-2,9-dienoyl-[acp]
* molecular weight:
+
** 416.686   
+
 
* Synonym(s):
 
* Synonym(s):
** oxocampestanol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-715]]
+
* [[RXN-16628]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a (2E,9Z)-octadeca-2,9-dienoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200917 25200917]
+
{{#set: consumed by=RXN-16628}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15789 C15789]
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N}}
+
{{#set: common name=6-oxocampestanol}}
+
{{#set: molecular weight=416.686    }}
+
{{#set: common name=oxocampestanol}}
+
{{#set: consumed by=RXN-715}}
+

Latest revision as of 20:44, 21 March 2018

Metabolite 2E-9Z-octadeca-2-9-dienoyl-ACPs

  • common name:
    • a (2E,9Z)-octadeca-2,9-dienoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (2E,9Z)-octadeca-2,9-dienoyl-[acp" cannot be used as a page name in this wiki.