Difference between revisions of "Ec-08 003040"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] == * smiles: ** C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+] * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-08_003040 == * left end position: ** 2891683 * transcription direction: ** POSITIVE * right end position: ** 2894665 * centisome position: ** 43.1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_003040 == |
− | * | + | * left end position: |
− | ** | + | ** 2891683 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2894665 |
− | * | + | * centisome position: |
− | ** | + | ** 43.178356 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0281_0045 |
− | ** | + | ** Esi0281_0045 |
− | ** | + | ** QCR |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.10.2.2-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-14107]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-15816]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-15829]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6692]] | ||
+ | * [[PWY-7279]] | ||
+ | * [[PWY-7082]] | ||
+ | * [[PWY-3781]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2891683}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2894665}} | |
− | + | {{#set: centisome position=43.178356 }} | |
− | + | {{#set: common name=Esi_0281_0045|Esi0281_0045|QCR}} | |
− | + | {{#set: reaction associated=1.10.2.2-RXN|RXN-14107|RXN-15816|RXN-15829}} | |
− | + | {{#set: pathway associated=PWY-6692|PWY-7279|PWY-7082|PWY-3781}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:44, 21 March 2018
Gene Ec-08_003040
- left end position:
- 2891683
- transcription direction:
- POSITIVE
- right end position:
- 2894665
- centisome position:
- 43.178356
- Synonym(s):
- Esi_0281_0045
- Esi0281_0045
- QCR
Reactions associated
- Reaction: 1.10.2.2-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14107
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15816
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15829
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome