Difference between revisions of "RXN-17113"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL MANNITOL] == * smiles: ** C(C(C(C(C(CO)O)O)O)O)O * common name: ** D-mannitol * inchi...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17113 RXN-17113] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-CoA oxidase, partial *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL MANNITOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17113 RXN-17113] ==
−
* smiles:
+
* direction:
−
** C(C(C(C(C(CO)O)O)O)O)O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** D-mannitol
+
** acyl-CoA oxidase, partial
−
* inchi key:
+
** acyl-CoA oxidase
−
** InChIKey=FBPFZTCFMRRESA-KVTDHHQDSA-N
+
** Acyl-CoA oxidase/dehydrogenase, central domain
−
* molecular weight:
+
* ec number:
−
** 182.173   
+
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
−
** D-mitobronitol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[biomass_rxn]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-18491]][c] '''=>''' 1 [[CPD-18492]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
−
* [[MANNITOL-1-PHOSPHATASE-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 oxygen[c] '''+''' 1 (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA[c] '''=>''' 1 (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA[c] '''+''' 1 hydrogen peroxide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-22_002920]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-08_006390]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-26_004320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7726]], (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726]
 +
** '''13''' reactions found over '''13''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 69-65-8
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC16899
+
{{#set: common name=acyl-CoA oxidase, partial}}
−
* DRUGBANK : DB00742
+
{{#set: common name=acyl-CoA oxidase}}
−
* PUBCHEM:
+
{{#set: common name=Acyl-CoA oxidase/dehydrogenase, central domain}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6251 6251]
+
{{#set: ec number=EC-1.3.3.6}}
−
* HMDB : HMDB00765
+
{{#set: gene associated=Ec-22_002920|Ec-08_006390|Ec-26_004320}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7726}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00392 C00392]
+
{{#set: reconstruction category=annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.chemspider.com/Chemical-Structure.6015.html 6015]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16899 16899]
+
−
* BIGG : 34845
+
−
{{#set: smiles=C(C(C(C(C(CO)O)O)O)O)O}}
+
−
{{#set: common name=D-mannitol}}
+
−
{{#set: inchi key=InChIKey=FBPFZTCFMRRESA-KVTDHHQDSA-N}}
+
−
{{#set: molecular weight=182.173    }}
+
−
{{#set: common name=D-mitobronitol}}
+
−
{{#set: consumed by=biomass_rxn}}
+
−
{{#set: produced by=MANNITOL-1-PHOSPHATASE-RXN}}
+

Latest revision as of 19:44, 21 March 2018

Reaction RXN-17113

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-CoA oxidase, partial
    • acyl-CoA oxidase
    • Acyl-CoA oxidase/dehydrogenase, central domain
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 oxygen[c] + 1 (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA[c] => 1 (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA[c] + 1 hydrogen peroxide[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7726, (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): PWY-7726
    • 13 reactions found over 13 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-17113&oldid=29082"