Difference between revisions of "Cis-delta5-3-oxo-lignoceroyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] == * smiles: ** C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta5-3-oxo-lignoceroyl-ACPs cis-delta5-3-oxo-lignoceroyl-ACPs] == * common name: ** a cis...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta5-3-oxo-lignoceroyl-ACPs cis-delta5-3-oxo-lignoceroyl-ACPs] ==
−
* smiles:
+
−
** C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
+
−
* inchi key:
+
−
** InChIKey=ZAWIXNGTTZTBKV-JMVOWJSSSA-F
+
 
* common name:
 
* common name:
−
** D-myo-inositol (1,3,4,6)-tetrakisphosphate
+
** a cis-delta5-3-oxo-C24:1-[acp]
−
* molecular weight:
+
−
** 492.013   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(1,3,4,6)P4
 
−
** inositol (1,3,4,6)-tetrakisphosphate
 
−
** 1D-myo -inositol 1,3,4,6-tetrakisphosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2.7.1.140-RXN]]
+
* [[RXN1G-72]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[2.7.1.133-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a cis-delta5-3-oxo-C24:1-[acp]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04477 C04477]
+
{{#set: consumed by=RXN1G-72}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57660 57660]
+
−
* METABOLIGHTS : MTBLC57660
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201336 25201336]
+
−
* HMDB : HMDB01187
+
−
{{#set: smiles=C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}}
+
−
{{#set: inchi key=InChIKey=ZAWIXNGTTZTBKV-JMVOWJSSSA-F}}
+
−
{{#set: common name=D-myo-inositol (1,3,4,6)-tetrakisphosphate}}
+
−
{{#set: molecular weight=492.013    }}
+
−
{{#set: common name=Ins(1,3,4,6)P4|inositol (1,3,4,6)-tetrakisphosphate|1D-myo -inositol 1,3,4,6-tetrakisphosphate}}
+
−
{{#set: consumed by=2.7.1.140-RXN}}
+
−
{{#set: produced by=2.7.1.133-RXN}}
+

Latest revision as of 20:44, 21 March 2018

Metabolite cis-delta5-3-oxo-lignoceroyl-ACPs

  • common name:
    • a cis-delta5-3-oxo-C24:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta5-3-oxo-C24:1-[acp" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Cis-delta5-3-oxo-lignoceroyl-ACPs&oldid=29097"