Difference between revisions of "Ec-02 005420"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=SECPZKHBE...") |
(Created page with "Category:Gene == Gene Ec-02_005420 == * left end position: ** 5678295 * transcription direction: ** NEGATIVE * right end position: ** 5684406 * centisome position: ** 86.9...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_005420 == |
− | * | + | * left end position: |
− | ** | + | ** 5678295 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5684406 |
− | * | + | * centisome position: |
− | ** | + | ** 86.98647 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0024_0177 |
− | ** | + | ** Esi0024_0177 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GLYOXIII-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: automated-name-match | |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=5678295}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5684406}} | |
− | + | {{#set: centisome position=86.98647 }} | |
− | + | {{#set: common name=Esi_0024_0177|Esi0024_0177}} | |
− | + | {{#set: reaction associated=GLYOXIII-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:45, 21 March 2018
Gene Ec-02_005420
- left end position:
- 5678295
- transcription direction:
- NEGATIVE
- right end position:
- 5684406
- centisome position:
- 86.98647
- Synonym(s):
- Esi_0024_0177
- Esi0024_0177
Reactions associated
- Reaction: GLYOXIII-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome