Difference between revisions of "CPD-10794"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2006 RXN-2006] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10794 CPD-10794] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2006 RXN-2006] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10794 CPD-10794] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC4(C(O)C(O)C(O4)OP(=O)([O-])[O-]))(=O)[O-]
 +
* inchi key:
 +
** InChIKey=CUNFRFHBHMFVPH-TYASJMOZSA-J
 +
* common name:
 +
** ADP ribose 1''-phosphate
 +
* molecular weight:
 +
** 635.268   
 
* Synonym(s):
 
* Synonym(s):
 +
** adenosine diphosphate ribose 1'' phosphate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-10034]]
** 1 [[CO-A]][c] '''+''' 1 [[CPD-514]][c] '''=>''' 1 [[BENZOYLCOA]][c] '''+''' 1 [[ACETYL-COA]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-12055]]
** 1 coenzyme A[c] '''+''' 1 3-oxo-3-phenylpropanoyl-CoA[c] '''=>''' 1 benzoyl-CoA[c] '''+''' 1 acetyl-CoA[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-26_003940]]
+
** [[pantograph]]-[[aragem]]
+
== Pathways  ==
+
* [[P281-PWY]], 3-phenylpropanoate degradation: [http://metacyc.org/META/NEW-IMAGE?object=P281-PWY P281-PWY]
+
** '''1''' reactions found over '''9''' reactions in the full pathway
+
* [[PWY-481]], ethylbenzene degradation (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-481 PWY-481]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-6458]], benzoyl-CoA biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6458 PWY-6458]
+
** '''1''' reactions found over '''3''' reactions in the full pathway
+
* [[PWY-6443]], benzoate biosynthesis I (CoA-dependent, β-oxidative): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6443 PWY-6443]
+
** '''2''' reactions found over '''9''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-aragem]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R05506 R05506]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123525 44123525]
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC4(C(O)C(O)C(O4)OP(=O)([O-])[O-]))(=O)[O-]}}
{{#set: gene associated=Ec-26_003940}}
+
{{#set: inchi key=InChIKey=CUNFRFHBHMFVPH-TYASJMOZSA-J}}
{{#set: in pathway=P281-PWY|PWY-481|PWY-6458|PWY-6443}}
+
{{#set: common name=ADP ribose 1''-phosphate}}
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=635.268    }}
{{#set: reconstruction source=orthology-aragem}}
+
{{#set: common name=adenosine diphosphate ribose 1'' phosphate}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-10034}}
 +
{{#set: produced by=RXN-12055}}

Latest revision as of 20:45, 21 March 2018

Metabolite CPD-10794

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC4(C(O)C(O)C(O4)OP(=O)([O-])[O-]))(=O)[O-]
  • inchi key:
    • InChIKey=CUNFRFHBHMFVPH-TYASJMOZSA-J
  • common name:
    • ADP ribose 1-phosphate
  • molecular weight:
    • 635.268
  • Synonym(s):
    • adenosine diphosphate ribose 1 phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC4(C(O)C(O)C(O4)OP(=O)([O-])[O-]))(=O)[O-" cannot be used as a page name in this wiki.