Difference between revisions of "CPD-13695"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7931 RXN-7931] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/5.3.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13695 CPD-13695] == * smiles: ** CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13695 CPD-13695] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZVFUUGBGZMBUAN-KZNRQMKSSA-J |
| + | * common name: | ||
| + | ** 3,24-dioxocholest-4-en-26-oyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 1174.098 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** cholest-4-en--3,24,dione-26-oyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12705]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659292 90659292] |
| − | + | {{#set: smiles=CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}} | |
| − | + | {{#set: inchi key=InChIKey=ZVFUUGBGZMBUAN-KZNRQMKSSA-J}} | |
| − | {{#set: | + | {{#set: common name=3,24-dioxocholest-4-en-26-oyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=1174.098 }} |
| − | {{#set: | + | {{#set: common name=cholest-4-en--3,24,dione-26-oyl-CoA}} |
| − | {{#set: | + | {{#set: produced by=RXN-12705}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite CPD-13695
- smiles:
- CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
- inchi key:
- InChIKey=ZVFUUGBGZMBUAN-KZNRQMKSSA-J
- common name:
- 3,24-dioxocholest-4-en-26-oyl-CoA
- molecular weight:
- 1174.098
- Synonym(s):
- cholest-4-en--3,24,dione-26-oyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))" cannot be used as a page name in this wiki.
