Difference between revisions of "FERULOYL-COA"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17113 RXN-17113] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-CoA oxidase, partial *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULOYL-COA FERULOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULOYL-COA FERULOYL-COA] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
| + | * inchi key: | ||
| + | ** InChIKey=GBXZVJQQDAJGSO-NBXNMEGSSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** feruloyl-CoA |
| − | * | + | * molecular weight: |
| − | + | ** 939.674 | |
| − | + | ||
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| + | ** trans-feruloyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-1106]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] | |
| − | + | * [[6.2.1.34-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | = | + | |
| − | + | ||
| − | * | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229137 44229137] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57276 57276] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00406 C00406] |
| − | {{#set: | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=GBXZVJQQDAJGSO-NBXNMEGSSA-J}} |
| − | + | {{#set: common name=feruloyl-CoA}} | |
| − | + | {{#set: molecular weight=939.674 }} | |
| + | {{#set: common name=trans-feruloyl-CoA}} | ||
| + | {{#set: consumed by=RXN-1106}} | ||
| + | {{#set: produced by=CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN|6.2.1.34-RXN}} | ||
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite FERULOYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- inchi key:
- InChIKey=GBXZVJQQDAJGSO-NBXNMEGSSA-J
- common name:
- feruloyl-CoA
- molecular weight:
- 939.674
- Synonym(s):
- trans-feruloyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
