Difference between revisions of "CPD-18761"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-163 RXN66-163] == * direction: ** LEFT-TO-RIGHT * common name: ** Monooxygenase, FAD-binding...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-163 RXN66-163] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** COC1(=CC(=CCCO)C=CC(=O)1)
 +
* inchi key:
 +
** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** Monooxygenase, FAD-binding
+
** coniferyl alcohol radical
−
** Aromatic-ring hydroxylase-like
+
* molecular weight:
−
* ec number:
+
** 179.195   
−
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-2742]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-2751]][c] '''+''' 1 [[WATER]][c]
+
* [[RXN-17352]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 oxygen[c] '''+''' 1 cotinine[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 5'-hydroxycotinine[c] '''+''' 1 H2O[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-26_003280]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-01_010880]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-00_001320]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY66-221]], nicotine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-221 PWY66-221]
+
−
** '''3''' reactions found over '''18''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}}
−
{{#set: common name=Monooxygenase, FAD-binding}}
+
{{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}}
−
{{#set: common name=Aromatic-ring hydroxylase-like}}
+
{{#set: common name=coniferyl alcohol radical}}
−
{{#set: ec number=EC-1.14.14.1}}
+
{{#set: molecular weight=179.195    }}
−
{{#set: gene associated=Ec-26_003280|Ec-01_010880|Ec-00_001320}}
+
{{#set: produced by=RXN-17352}}
−
{{#set: in pathway=PWY66-221}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:46, 21 March 2018

Metabolite CPD-18761

  • smiles:
    • COC1(=CC(=CCCO)C=CC(=O)1)
  • inchi key:
    • InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
  • common name:
    • coniferyl alcohol radical
  • molecular weight:
    • 179.195
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-18761&oldid=29185"